CymitQuimica logo

CAS 1439903-14-6

:

4-Amino-1-(cyclopropylmethyl)-2(1H)-pyridinone

Description:
4-Amino-1-(cyclopropylmethyl)-2(1H)-pyridinone is a chemical compound characterized by its pyridinone structure, which features a pyridine ring with an amino group and a cyclopropylmethyl substituent. This compound typically exhibits properties associated with both aromatic and aliphatic systems due to the presence of the pyridine ring and the cyclopropyl group. It is likely to be a solid at room temperature, with potential solubility in polar solvents, given the presence of the amino group that can engage in hydrogen bonding. The compound may exhibit biological activity, potentially acting as a pharmacophore in medicinal chemistry, although specific biological properties would depend on further studies. Its molecular structure suggests it could participate in various chemical reactions, including nucleophilic substitutions and hydrogen bonding interactions. As with many organic compounds, safety and handling precautions should be observed, particularly in laboratory settings.
Formula:C9H12N2O
InChI:InChI=1S/C9H12N2O/c10-8-3-4-11(9(12)5-8)6-7-1-2-7/h3-5,7H,1-2,6,10H2
InChI key:InChIKey=NRWQAICWESUEPT-UHFFFAOYSA-N
SMILES:C(N1C(=O)C=C(N)C=C1)C2CC2
Synonyms:
  • 4-Amino-1-(cyclopropylmethyl)-2(1H)-pyridinone
  • 2(1H)-Pyridinone, 4-amino-1-(cyclopropylmethyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.