CymitQuimica logo

CAS 1439903-16-8

:

1-[[2-(Trifluoromethyl)phenyl]methyl]-1H-imidazole-2-carboxylic acid

Description:
1-[[2-(Trifluoromethyl)phenyl]methyl]-1H-imidazole-2-carboxylic acid is a chemical compound characterized by its imidazole ring, which is a five-membered aromatic heterocycle containing two nitrogen atoms. The presence of a trifluoromethyl group (-CF3) on the phenyl ring significantly influences its electronic properties, enhancing lipophilicity and potentially affecting its biological activity. The carboxylic acid functional group (-COOH) contributes to its acidity and solubility in polar solvents, making it relevant in various chemical reactions and applications. This compound may exhibit interesting pharmacological properties, as imidazole derivatives are often explored for their roles in medicinal chemistry. Its structural features suggest potential interactions with biological targets, making it a candidate for further research in drug development. Additionally, the trifluoromethyl group is known to impart unique characteristics, such as increased metabolic stability and altered binding affinity, which are valuable in the design of pharmaceuticals. Overall, this compound represents a blend of structural complexity and functional diversity, making it a subject of interest in both synthetic and medicinal chemistry.
Formula:C12H9F3N2O2
InChI:InChI=1S/C12H9F3N2O2/c13-12(14,15)9-4-2-1-3-8(9)7-17-6-5-16-10(17)11(18)19/h1-6H,7H2,(H,18,19)
InChI key:InChIKey=WSRQIICSAJUGKF-UHFFFAOYSA-N
SMILES:C(C1=C(C(F)(F)F)C=CC=C1)N2C(C(O)=O)=NC=C2
Synonyms:
  • 1H-Imidazole-2-carboxylic acid, 1-[[2-(trifluoromethyl)phenyl]methyl]-
  • 1-[[2-(Trifluoromethyl)phenyl]methyl]-1H-imidazole-2-carboxylic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.