CAS 14400-94-3
:2,3,4,6-TETRABROMOPHENOL
Description:
2,3,4,6-Tetrabromophenol is an organic compound characterized by the presence of four bromine atoms attached to a phenolic ring. Its molecular structure features a hydroxyl group (-OH) and is known for its high bromine content, which contributes to its flame-retardant properties. This compound is typically a white to pale yellow solid and is soluble in organic solvents but has limited solubility in water. Due to its brominated nature, it exhibits significant stability and resistance to degradation, making it useful in various applications, including as a flame retardant in plastics and textiles. Additionally, 2,3,4,6-tetrabromophenol has been studied for its potential environmental impact and toxicity, particularly in aquatic systems, as brominated compounds can bioaccumulate and pose risks to wildlife. Safety precautions are necessary when handling this substance, as it may cause skin and eye irritation. Overall, its unique chemical properties make it a compound of interest in both industrial applications and environmental studies.
Formula:C6H2Br4O
InChI:InChI=1/C6H2Br4O/c7-2-1-3(8)6(11)5(10)4(2)9/h1,11H
InChI key:InChIKey=CXPJZISGVIVNEL-UHFFFAOYSA-N
SMILES:BrC1=C(Br)C(O)=C(Br)C=C1Br
Synonyms:- Phenol, 2,3,4,6-tetrabromo-
- 2,3,4,6-Tetrabromophenol
- 2,3,4,6-Tetrabromophenol Solution
- 2,3,4,6-Tetrabromophenol@100 μg/mL in Toluene
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
2,3,4,6-Tetrabromophenol
CAS:Controlled Product<p>Applications 2,3,4,6-Tetrabromophenol is a standard for environmental testing and research. Determination of urinary bromophenols (BrPs) as potential biomarkers for human exposure to polybrominated di-Ph ethers (PBDEs) using gas chromatography-tandem mass spectrometry (GC-MS/MS).<br> Not a dangerous good if item is equal to or less than 1g/ml and there is less than 100g/ml in the package<br>References Feng, C., et al.: J. Chromatogr. B: Analyt. Technol. Biomed. Life Sci., 1022, 70 (2016)<br></p>Formula:C6H2Br4OColor and Shape:NeatMolecular weight:409.7

