CAS 14401-73-1
:3,5-Dibromoacetophenone
Description:
3,5-Dibromoacetophenone is an organic compound characterized by the presence of bromine atoms at the 3 and 5 positions of the acetophenone structure. It features a ketone functional group, which is indicative of its reactivity and potential applications in organic synthesis. The compound typically appears as a solid at room temperature and is known for its white to pale yellow crystalline form. Its molecular formula reflects the presence of carbon, hydrogen, and bromine, contributing to its unique properties. 3,5-Dibromoacetophenone is often utilized in various chemical reactions, including as an intermediate in the synthesis of pharmaceuticals and agrochemicals. The bromine substituents enhance its electrophilic character, making it a useful reagent in electrophilic aromatic substitution reactions. Additionally, it may exhibit biological activity, which can be explored in medicinal chemistry. As with many brominated compounds, it is important to handle 3,5-dibromoacetophenone with care due to potential toxicity and environmental concerns associated with brominated organic compounds.
Formula:C8H6Br2O
InChI:InChI=1/C8H6Br2O/c1-5(11)6-2-7(9)4-8(10)3-6/h2-4H,1H3
InChI key:InChIKey=NHFJDRRYVMJBRJ-UHFFFAOYSA-N
SMILES:C(C)(=O)C1=CC(Br)=CC(Br)=C1
Synonyms:- 1-(3,5-Dibromophenyl)Ethanone
- 3',5'-Dibromoacetophenone
- 3,5-Dibromo Acetophenone
- 3,5-Dibromoacetophenone 99%Min
- Acetophenone, 3′,5′-dibromo-
- Ethanone, 1-(3,5-dibromophenyl)-
- 3,5-Dibromoacetophenone
- 3′,5′-Dibromoacetophenone
- Acetophenone, 3',5'-dibromo-
- 1-(3,5-dibromophenyl)ethan-1-one
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Ethanone, 1-(3,5-dibromophenyl)-
CAS:Formula:C8H6Br2OPurity:96%Color and Shape:SolidMolecular weight:277.94063',5'-Dibromoacetophenone
CAS:3',5'-Dibromoacetophenone is a reorienting agent that can be used in the synthesis of organic compounds. It has been shown to be useful in the synthesis of substituted phenols and other aromatic compounds. 3',5'-Dibromoacetophenone is also magnetic and can be used as a ligand in coordination reactions. The compound is often analysed by magnetic resonance spectroscopy, which can provide information about its protonation state.
Formula:C8H6Br2OPurity:Min. 95%Molecular weight:277.94 g/mol1-(3,5-Dibromophenyl)ethanone
CAS:Formula:C8H6Br2OPurity:95%Color and Shape:SolidMolecular weight:277.943



