CAS 144010-02-6
:1,2-Benzisothiazole, 3-(1-piperazinyl)-, hydrochloride (1:?)
Description:
1,2-Benzisothiazole, 3-(1-piperazinyl)-, hydrochloride (CAS 144010-02-6) is a chemical compound characterized by its heterocyclic structure, which includes a benzene ring fused to an isothiazole moiety. This compound features a piperazine group, which is a six-membered ring containing two nitrogen atoms, contributing to its potential biological activity. The hydrochloride form indicates that the compound is a salt, enhancing its solubility in water and making it suitable for various applications, particularly in pharmaceuticals. The presence of the piperazine moiety often suggests potential use in medicinal chemistry, as piperazine derivatives are known for their diverse pharmacological properties, including anxiolytic and antipsychotic effects. Additionally, the compound may exhibit antimicrobial or antifungal activities due to the isothiazole component. Its specific interactions and efficacy would depend on further studies, including structure-activity relationship analyses. Overall, this compound represents a class of substances that may have significant implications in drug development and therapeutic applications.
Formula:C11H13N3S·xClH
InChI:InChI=1S/C11H13N3S.ClH/c1-2-4-10-9(3-1)11(13-15-10)14-7-5-12-6-8-14;/h1-4,12H,5-8H2;1H
InChI key:InChIKey=DOQLJTKEUIJSKK-UHFFFAOYSA-N
SMILES:C=1(C=2C(SN1)=CC=CC2)N3CCNCC3.Cl
Synonyms:- 1,2-Benzisothiazole, 3-(1-piperazinyl)-, hydrochloride (1:?)
- 1,2-Benzisothiazole,3-(1-piperazinyl),hydrochloride
- 1-(1,2-Benzisothiazol-3-Yl)-Piperazine Hydrochloride
- 3-(Piperazin-1-Yl)-1,2-Benzothiazole Hydrochloride (1:1)
- 3-(Piperazin-1-Yl)Benzo[D]Isothiazole Hydrochloride
- 3-(Piperazin-1-yl)benzoisothiazole hydrochloride
- 3-Piperazinobenzisothiazole Hydrochloride
- 3-Piperazinyl-1,2-Benzisothiazole Hydrochloride
- 3-(1-Piperazinyl)-1,2-benzisothiazole hydrochloride
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
3-Piperazinobenzisothiazole Hydrochloride
CAS:Formula:C11H14ClN3SPurity:98%Color and Shape:SolidMolecular weight:255.76703-Piperazinobenzisothiazole Hydrochloride
CAS:3-Piperazinobenzisothiazole HydrochloridePurity:98%Molecular weight:255.77g/mol3-Piperazin-1-yl-benzo[d]isothiazole hydrochloride
CAS:<p>3-Piperazin-1-yl-benzo[d]isothiazole hydrochloride is an atypical antipsychotic that belongs to the group of inorganic compounds. It has been shown to have a high affinity for acidic surfaces and can be used in industrial applications such as the removal of metal ions from water by filtration. 3-Piperazin-1-yl-benzo[d]isothiazole hydrochloride is synthesized by reacting an inorganic base with a piperazine compound, followed by hydrolysis of the piperazine ring using acid. Impurities are often found during synthesis, which may contain traces of other compounds such as pyridine or methylamine.</p>Formula:C11H13N3SPurity:Min. 95%Color and Shape:PowderMolecular weight:219.31 g/mol


