CAS 14403-45-3
:L-B-imidazolelactic acid
Description:
L-B-imidazolelactic acid, with the CAS number 14403-45-3, is an organic compound characterized by its imidazole and lactic acid functional groups. This compound is a chiral molecule, typically existing in its L-form, which is significant in biological systems. It is known for its role in various biochemical processes, particularly in the metabolism of amino acids and as a potential precursor in the synthesis of biologically active compounds. L-B-imidazolelactic acid exhibits solubility in water and polar organic solvents, making it accessible for various applications in research and industry. Its structure allows for interactions with biological macromolecules, which may influence enzymatic activity and metabolic pathways. Additionally, it may possess antioxidant properties, contributing to its potential therapeutic applications. Overall, L-B-imidazolelactic acid is of interest in both pharmaceutical and biochemical research due to its unique structural features and biological relevance.
Formula:C6H8N2O3
InChI:InChI=1/C6H8N2O3/c9-5(6(10)11)1-4-2-7-3-8-4/h2-3,5,9H,1H2,(H,7,8)(H,10,11)/t5-/m0/s1
SMILES:C(c1cnc[nH]1)[C@@H](C(=O)O)O
Synonyms:- α-hydroxy-1H-Imidazole-4(5)-propanoicacid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
(S)-2-Hydroxy-3-(1H-imidazol-4-yl)propanoic acid
CAS:Formula:C6H8N2O3Purity:95%Color and Shape:SolidMolecular weight:156.1393L-beta-Imidazole lactic acid
CAS:L-beta-imidazole lactic acid is a monocarboxylic acid that has been shown to inhibit mutant strains of cancer cells, which are resistant to chemotherapeutic agents. It is an inhibitor of acetylcholine metabolism and has been shown to induce lysis in cultured human leukemic cells. L-beta-imidazole lactic acid has also been shown to be effective in the treatment of cancer patients with a specific mutation. This compound inhibits the growth of wild-type strains of cells and blocks biochemical pathways that lead to cell proliferation.Formula:C6H8N2O3Purity:Min. 95%Color and Shape:Brown SolidMolecular weight:156.14 g/molL-β-Imidazole Lactic Acid
CAS:Controlled ProductApplications L-beta-Imidazole lactic acid (CAS# 14403-45-3) is a useful research chemical compound.
Formula:C6H8N2O3Color and Shape:Off-WhiteMolecular weight:156.14



