CAS 144036-17-9

3-(CYCLOPENTYLOXY)-4-METHOXYBENZOIC ACID

Description:

3-(Cyclopentyloxy)-4-methoxybenzoic acid, with the CAS number 144036-17-9, is an organic compound characterized by its aromatic structure, which includes a benzoic acid moiety substituted with both a cyclopentyloxy group and a methoxy group. The presence of the cyclopentyloxy group contributes to its hydrophobic characteristics, while the methoxy group can influence its solubility and reactivity. This compound is likely to exhibit moderate polarity due to the carboxylic acid functional group, which can participate in hydrogen bonding. Its structural features suggest potential applications in pharmaceuticals or as a chemical intermediate, particularly in the synthesis of more complex organic molecules. The compound's stability, reactivity, and potential biological activity would depend on various factors, including pH, temperature, and the presence of other chemical species. Overall, 3-(cyclopentyloxy)-4-methoxybenzoic acid represents a unique combination of functional groups that may impart specific properties suitable for various chemical applications.

Formula: C₁₃H₁₆O₄

InChI: InChI=1/C13H16O4/c1-16-11-7-6-9(13(14)15)8-12(11)17-10-4-2-3-5-10/h6-8,10H,2-5H2,1H3,(H,14,15)

InChI key: InChIKey=RVADCQWIQKYXBJ-UHFFFAOYSA-N

SMILES: O(C1=C(OC)C=CC(C(O)=O)=C1)C2CCCC2

Synonyms:

• 3-(Cyclopentyloxy)-4-methoxybezoic acid
• Benzoic acid, 3-(cyclopentyloxy)-4-methoxy-
• Buttpark 75\04-33
• Rarechem Al Bo 1947
• 3-Cyclopentyloxy-4-methoxybenzoic acid
• 3-(Cyclopentyloxy)-4-methoxybenzoic acid

3-(Cyclopentyloxy)-4-methoxybenzoic acid

CAS: 144036-17-9

Formula: C₁₃H₁₆O₄

Purity: 99%

Color and Shape: Solid

Molecular weight: 236.2637

Ref: IN-DA00APO5

3-(Cyclopentyloxy)-4-methoxybenzoic acid

CAS: 144036-17-9

3-(Cyclopentyloxy)-4-methoxybenzoic acid

Purity: 95

Molecular weight: 236.26g/mol

Ref: 54-OR25693

3-Cyclopentyloxy-4-methoxybenzoic acid

CAS: 144036-17-9

Formula: C₁₃H₁₆O₄

Purity: 95.0%

Color and Shape: Solid

Molecular weight: 236.267

Ref: 10-F049406

3-(Cyclopentyloxy)-4-methoxybenzoic acid

CAS: 144036-17-9

3-(Cyclopentyloxy)-4-methoxybenzoic acid is a cyclic amide that has been shown to have anti-inflammatory properties. It has been shown to inhibit neutrophil migration, which may be due to its ability to block the activation of the anion channel on the cell membrane. 3-(Cyclopentyloxy)-4-methoxybenzoic acid also blocks the release of reactive oxygen species from neutrophils, preventing cellular damage and organ dysfunction. This compound is used in biological studies as well as for treatment of pulmonary diseases such as colitis.

Formula: C₁₃H₁₆O₄

Purity: Min. 95%

Molecular weight: 236.26 g/mol

Ref: 3D-UFA03617