CAS 1440519-93-6
:6-Fluoro-2,3-dihydro-3,3-dimethyl-1H-isoindol-1-one
Description:
6-Fluoro-2,3-dihydro-3,3-dimethyl-1H-isoindol-1-one is a chemical compound characterized by its isoindole structure, which features a fused bicyclic system. The presence of a fluorine atom at the 6-position contributes to its unique reactivity and potential biological activity. The compound also contains two methyl groups at the 3-position, enhancing its lipophilicity and possibly influencing its pharmacokinetic properties. As a dihydro derivative, it exhibits a saturated ring system, which can affect its stability and interaction with biological targets. This compound may be of interest in medicinal chemistry due to its structural features that could lead to the development of novel therapeutic agents. Its CAS number, 1440519-93-6, allows for precise identification in chemical databases. Overall, the characteristics of this compound suggest potential applications in drug discovery and development, particularly in areas where fluorinated compounds are known to exhibit enhanced biological activity.
Formula:C10H10FNO
InChI:InChI=1S/C10H10FNO/c1-10(2)8-4-3-6(11)5-7(8)9(13)12-10/h3-5H,1-2H3,(H,12,13)
InChI key:InChIKey=JAJYBBIBKMDZAN-UHFFFAOYSA-N
SMILES:O=C1C=2C(C(C)(C)N1)=CC=C(F)C2
Synonyms:- 1H-Isoindol-1-one, 6-fluoro-2,3-dihydro-3,3-dimethyl-
- 6-Fluoro-2,3-dihydro-3,3-dimethyl-1H-isoindol-1-one
- 6-Fluoro-3,3-dimethyl-2,3-dihydro-isoindol-1-one
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
6-Fluoro-3,3-dimethyl-2,3-dihydro-isoindol-1-one
CAS:Controlled ProductFormula:C10H10FNOColor and Shape:NeatMolecular weight:179.191
