CymitQuimica logo

CAS 1440605-46-8

:

Methyl 7-chloro-6,7,8-trideoxy-6-[[[(2R,4R)-1-methyl-4-propyl-2-pyrrolidinyl]carbonyl]amino]-1-thio-L-threo-α-D-galacto-octopyranoside

Description:
Methyl 7-chloro-6,7,8-trideoxy-6-[[[(2R,4R)-1-methyl-4-propyl-2-pyrrolidinyl]carbonyl]amino]-1-thio-L-threo-α-D-galacto-octopyranoside, identified by CAS number 1440605-46-8, is a complex organic compound characterized by its intricate molecular structure, which includes multiple functional groups such as a thioether, amide, and a pyrrolidine moiety. This compound features a chlorinated sugar derivative, indicating potential biological activity, particularly in the context of glycosylation processes or as a potential inhibitor in enzymatic reactions. Its stereochemistry, denoted by specific configurations at various chiral centers, suggests that it may exhibit selective interactions with biological targets, making it of interest in medicinal chemistry and drug development. The presence of the methyl and propyl groups on the pyrrolidine ring may influence its lipophilicity and membrane permeability, which are critical factors in pharmacokinetics. Overall, this compound's unique structural features position it as a candidate for further research in therapeutic applications, particularly in areas related to carbohydrate chemistry and drug design.
Formula:C18H33ClN2O5S
InChI:InChI=1S/C18H33ClN2O5S/c1-5-6-10-7-11(21(3)8-10)17(25)20-12(9(2)19)16-14(23)13(22)15(24)18(26-16)27-4/h9-16,18,22-24H,5-8H2,1-4H3,(H,20,25)/t9-,10+,11+,12+,13-,14+,15+,16+,18+/m0/s1
InChI key:InChIKey=KDLRVYVGXIQJDK-KEPWRCPUSA-N
SMILES:[C@@H](NC(=O)[C@H]1C[C@@H](CCC)CN1C)([C@H](C)Cl)[C@]2(O[C@H](SC)[C@H](O)[C@@H](O)[C@H]2O)[H]
Synonyms:
  • Methyl 7-chloro-6,7,8-trideoxy-6-[[[(2R,4R)-1-methyl-4-propyl-2-pyrrolidinyl]carbonyl]amino]-1-thio-L-threo-α-D-galacto-octopyranoside
  • L-threo-α-D-galacto-Octopyranoside, methyl 7-chloro-6,7,8-trideoxy-6-[[[(2R,4R)-1-methyl-4-propyl-2-pyrrolidinyl]carbonyl]amino]-1-thio-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.