CymitQuimica logo

CAS 144069-70-5

:

(2R,4S)-1-tert-butoxycarbonyl-4-phenyl-pyrrolidine-2-carboxylic acid

Description:
(2R,4S)-1-tert-butoxycarbonyl-4-phenyl-pyrrolidine-2-carboxylic acid is a chiral compound characterized by its pyrrolidine backbone, which features a tert-butoxycarbonyl (Boc) protecting group and a phenyl substituent at the 4-position. This compound is notable for its potential applications in organic synthesis and medicinal chemistry, particularly in the development of peptide-based therapeutics. The presence of the carboxylic acid functional group contributes to its acidity and reactivity, making it suitable for various chemical transformations. The specific stereochemistry indicated by the (2R,4S) configuration is crucial for its biological activity, as chirality can significantly influence the interaction of the molecule with biological targets. Additionally, the compound's solubility and stability can be affected by the presence of the Boc group, which can be removed under acidic conditions to yield the corresponding amine. Overall, this compound exemplifies the complexity and utility of chiral molecules in chemical research and development.
Formula:C16H21NO4
InChI:InChI=1/C16H21NO4/c1-16(2,3)21-15(20)17-10-12(9-13(17)14(18)19)11-7-5-4-6-8-11/h4-8,12-13H,9-10H2,1-3H3,(H,18,19)/t12-,13-/m1/s1
SMILES:CC(C)(C)OC(=O)N1C[C@@H](C[C@@H]1C(=O)O)c1ccccc1
Synonyms:
  • (4S)-1-(tert-Butoxycarbonyl)-4-phenyl-D-proline
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.