CAS 144074-96-4
:pneumocandin C(0)
Description:
Pneumocandin C(0) is a lipopeptide compound that belongs to the echinocandin class of antifungal agents. It is primarily derived from the fermentation of certain fungi, particularly Glarea lozoyensis. This compound exhibits potent antifungal activity, particularly against Candida and Aspergillus species, by inhibiting the synthesis of β-(1,3)-D-glucan, an essential component of fungal cell walls. Pneumocandin C(0) is characterized by its complex structure, which includes a cyclic hexapeptide backbone and a fatty acid side chain, contributing to its lipophilicity and biological activity. The compound is typically administered intravenously due to its poor oral bioavailability. Its pharmacokinetics involve distribution throughout the body, with a focus on the liver and kidneys, and it is primarily eliminated via hepatic metabolism. Pneumocandin C(0) has been studied for its potential in treating invasive fungal infections, making it a significant subject of research in the field of medical mycology and antifungal therapy.
Formula:C50H80N8O17
InChI:InChI=1/C50H80N8O17/c1-5-25(2)18-26(3)12-10-8-6-7-9-11-13-38(66)52-32-21-36(64)47(72)56-46(71)34-20-31(62)24-58(34)50(75)40(35(63)22-37(51)65)54-48(73)41(43(68)42(67)28-14-16-29(60)17-15-28)55-45(70)33-19-30(61)23-57(33)49(74)39(27(4)59)53-44(32)69/h14-17,25-27,30-36,39-43,47,59-64,67-68,72H,5-13,18-24H2,1-4H3,(H2,51,65)(H,52,66)(H,53,69)(H,54,73)(H,55,70)(H,56,71)/t25?,26?,27-,30-,31-,32?,33+,34+,35-,36+,39+,40+,41+,42-,43?,47-/m1/s1
Synonyms:- Pneumocandin C0
- Pneumocandin Bo, 6-(trans-4-hydroxy-L-proline)-
- Pneumocandin C(0)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
Ref: 4Z-PC-155007
Discontinued product

