CAS 144084-01-5
:1-O-Acetyl-2,3,5-tri-O-(4-chlorobenzoyl)-beta-D-ribofuranose
Description:
1-O-Acetyl-2,3,5-tri-O-(4-chlorobenzoyl)-beta-D-ribofuranose is a complex carbohydrate derivative characterized by its ribofuranose sugar backbone, which is a five-membered ring structure. This compound features multiple acylation modifications, specifically three 4-chlorobenzoyl groups attached to the hydroxyl positions at C-2, C-3, and C-5, along with an acetyl group at the C-1 position. The presence of the chlorobenzoyl groups enhances its lipophilicity and may influence its biological activity, making it of interest in medicinal chemistry and glycoscience. The acetyl group can also affect the compound's reactivity and stability. This substance is typically used in research settings, particularly in studies related to carbohydrate chemistry, synthesis of glycosides, and potential applications in drug development. Its unique structure may also impart specific interactions with biological targets, making it a candidate for further investigation in pharmacological studies. As with many synthetic compounds, careful handling and characterization are essential to ensure safety and efficacy in its applications.
Formula:C28H21Cl3O9
InChI:InChI=1/C28H21Cl3O9/c1-15(32)37-28-24(40-27(35)18-6-12-21(31)13-7-18)23(39-26(34)17-4-10-20(30)11-5-17)22(38-28)14-36-25(33)16-2-8-19(29)9-3-16/h2-13,22-24,28H,14H2,1H3/t22-,23-,24-,28-/m1/s1
SMILES:CC(=O)O[C@H]1[C@@H]([C@@H]([C@@H](COC(=O)c2ccc(cc2)Cl)O1)OC(=O)c1ccc(cc1)Cl)OC(=O)c1ccc(cc1)Cl
Synonyms:- 1-O-Acetyl-2,3,5-Tri-O-P-Chlorobenzoyl-Beta-D-Ribofuranose
- 1-O-Acetyl-2,3,5-tri-O-(p-chlorobenzoyl)-β-D-ribofuranose
- (2S,3R,4R,5R)-2-acetoxy-5-((4-chlorobenzoyloxy)methyl)tetrahydrofuran-3,4-diyl bis(4-chlorobenzoate)
- 1-O-Acetyl 2,3,5-Tri-O-p-chlorobenzoyl--D-ribofuranoside
- 1-O-acetyl-2,3,5-tris-O-(4-chlorobenzoyl)-beta-D-ribofuranose
- β-D-Ribofuranose 1-Acetate 2,3,5-Tris(4-chlorobenzoate)
- 1-O-Acetyl-2,3,5-tri-O-(4-chlorobenzoyl)-β-D-ribofuranose
- 1-O-ACETYL-2,3,5-TRI-O-(4-CHLOROBENZOYL)-BETA-D-RIBOFURANOSE
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
1-O-Acetyl 2,3,5-Tri-O-p-chlorobenzoyl-b-D-ribofuranoside
CAS:Formula:C28H21Cl3O9Color and Shape:SolidMolecular weight:607.81991-O-Acetyl 2,3,5-Tri-O-p-chlorobenzoyl-β-D-ribofuranoside
CAS:Controlled Product<p>Applications Used in the synthesis of Clitocine.<br>References Moss, R., et al.: J. Med. Chem., 31, 786 (1988),<br></p>Formula:C28H21Cl3O9Color and Shape:NeatMolecular weight:607.821-O-Acetyl-2,3,5-tri-O-p-chlorobenzoyl-b-D-ribofuranose
CAS:1-O-Acetyl-2,3,5-tri-O-p-chlorobenzoyl-b-D-ribofuranose is a modified monosaccharide that is synthesized by the methylation of 2,3,5,6'-tetraacetyl bromoacetyl bromoacetate with sodium methoxide in methanol and acetone. The compound is then reacted with formaldehyde and acetic anhydride to produce 1-(4'-chlorobenzoyl)-2,3,5,-triacetoxybibofuranoside. The product is then treated with phosphoryl chloride to generate 1-(4'-chlorobenzoyl)-2,3,5,-triacetoxybibofuranoside O-(1'',2'''-dichloroethyl) ether. This product has been used as a complex carbohydrate in the synthesis of oligosaccharides orFormula:C28H21Cl3O9Purity:Min. 95%Molecular weight:607.82 g/mol



