CAS 144096-47-9
:4H-1-Benzopyran-4-one,6-ethyl-4a,5,6,7-tetrahydro-4a,5-dihydroxy-, (4aS,5R,6R)-
Description:
4H-1-Benzopyran-4-one, 6-ethyl-4a,5,6,7-tetrahydro-4a,5-dihydroxy-, with the CAS number 144096-47-9, is a chemical compound that belongs to the class of flavonoids, which are known for their diverse biological activities. This compound features a benzopyran structure, characterized by a fused benzene and pyran ring, and contains multiple hydroxyl groups that contribute to its potential antioxidant properties. The presence of an ethyl group enhances its lipophilicity, which may influence its bioavailability and interaction with biological systems. The stereochemistry indicated by the (4aS,5R,6R) configuration suggests specific spatial arrangements of its atoms, which can significantly affect its reactivity and interaction with enzymes or receptors. Compounds of this nature are often studied for their pharmacological effects, including anti-inflammatory and anticancer properties. Additionally, the structural features of this compound may allow it to participate in various chemical reactions, making it of interest in both synthetic and medicinal chemistry.
Formula:C11H14O4
InChI:InChI=1S/C11H14O4/c1-2-7-3-4-9-11(14,10(7)13)8(12)5-6-15-9/h4-7,10,13-14H,2-3H2,1H3/t7-,10-,11-/m1/s1
InChI key:InChIKey=JNJNTFPIOCKSTA-AVPPRXQKSA-N
SMILES:O[C@]12C(=CC[C@@H](CC)[C@H]1O)OC=CC2=O
Synonyms:- (4aS,5R,6R)-6-Ethyl-4a,5,6,7-tetrahydro-4a,5-dihydroxy-4H-1-benzopyran-4-one
- 4H-1-Benzopyran-4-one,6-ethyl-4a,5,6,7-tetrahydro-4a,5-dihydroxy-, [4aS-(4aa,5b,6b)]-
- Agistatin D
- 4H-1-Benzopyran-4-one, 6-ethyl-4a,5,6,7-tetrahydro-4a,5-dihydroxy-, (4aS,5R,6R)-
- Agistatine D
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
4H-1-Benzopyran-4-one, 6-ethyl-4a,5,6,7-tetrahydro-4a,5-dihydroxy-, (4aS,5R,6R)-
CAS:Formula:C11H14O4Molecular weight:210.2265Agistatin D
CAS:<p>Agistatin D is a metabolite of the fungus Penicillium agaricoides. It has been shown to have antimicrobial activity against Gram-negative bacteria such as Escherichia coli and Pseudomonas aeruginosa, as well as some Gram-positive bacteria such as Staphylococcus aureus. Agistatin D's antimicrobial activity is due in part to its ability to inhibit the growth of target organisms through inhibition of protein synthesis by binding to ribosomes. This compound also inhibits the production of certain secondary metabolites (e.g., indole-3-acetic acid) that are often associated with plant pathogenicity. The organic solvent used in this study was methanol, which was evaporated before extraction and analysis.</p>Formula:C11H14O4Purity:Min. 95%Molecular weight:210.23 g/mol
