CAS 1441-02-7: Phenol, 2,3,4,5,6-pentachloro-, 1-acetate
Description:Phenol, 2,3,4,5,6-pentachloro-, 1-acetate, commonly referred to as pentachlorophenol acetate, is a chlorinated aromatic compound characterized by the presence of five chlorine atoms attached to a phenolic ring, along with an acetate functional group. This compound is typically a white to pale yellow solid and is known for its high stability and resistance to degradation. It exhibits significant lipophilicity, allowing it to bioaccumulate in living organisms. Pentachlorophenol acetate is primarily recognized for its use as a pesticide and biocide, particularly in wood preservation and as a fungicide. However, due to its environmental persistence and potential toxicity to aquatic life and humans, its use is heavily regulated in many countries. The compound's chemical properties include a relatively high melting point and low solubility in water, which contribute to its effectiveness in various applications but also raise concerns regarding environmental impact and human health. Proper handling and disposal are essential to mitigate risks associated with exposure to this substance.
Formula:C8H3Cl5O2
InChI:InChI=1S/C8H3Cl5O2/c1-2(14)15-8-6(12)4(10)3(9)5(11)7(8)13/h1H3
InChI key:InChIKey=RRYATXLRCBOQTJ-UHFFFAOYSA-N
SMILES:O=C(OC=1C(Cl)=C(Cl)C(Cl)=C(Cl)C1Cl)C
- Synonyms:
- 2,3,4,5,6-Pentachlorophenyl acetate
- NSC 21472
- Pentachloro-Phenoacetate
- Pentachlorophenyl Acetate
- Pentachlorphenylacetat Pestanal Packung
- Phenol, 2,3,4,5,6-pentachloro-, 1-acetate
- Phenol, pentachloro-, acetate
- Rabcon
- Pentachlorophenol acetate

Phenol, 2,3,4,5,6-pentachloro-, 1-acetate
Ref: IN-DA001IXJ
10mg | 146.00 € | ||
100mg | 634.00 € |

Pentachlorophenol acetate 100 µg/mL in Cyclohexane
Controlled ProductRef: 04-XA15971000CY
1ml | 30.00 € |

Pentachlorophenol acetate
Controlled ProductRef: 04-C15971000
100mg | 181.00 € |

Pentachlorophenol acetate 10 µg/mL in Cyclohexane
Controlled ProductRef: 04-L15971000CY
10ml | 96.00 € |

Pentachlorophenyl acetate
Controlled ProductRef: TR-P238180
1g | 1,136.00 € |