CAS 1441-98-1

1-[2-(Methylseleno)phenyl]ethanone

Description:

1-[2-(Methylseleno)phenyl]ethanone, with the CAS number 1441-98-1, is an organoselenium compound characterized by the presence of a methylseleno group attached to a phenyl ring, along with an ethanone functional group. This compound typically exhibits a molecular structure that includes a selenium atom bonded to a methyl group and a phenyl group, which can influence its reactivity and biological properties. Organoselenium compounds are known for their potential antioxidant activities and roles in biological systems, often being studied for their effects in medicinal chemistry. The presence of the ethanone moiety suggests that this compound may participate in various chemical reactions, including nucleophilic attacks and electrophilic substitutions. Additionally, the unique properties of selenium can impart distinct characteristics, such as altered solubility and reactivity compared to similar sulfur-containing compounds. Overall, 1-[2-(Methylseleno)phenyl]ethanone represents a fascinating area of study within organoselenium chemistry, with potential applications in pharmaceuticals and materials science.

Formula: C₉H₁₀OSe

InChI: InChI=1S/C9H10OSe/c1-7(10)8-5-3-4-6-9(8)11-2/h3-6H,1-2H3

InChI key: InChIKey=IDYYOSKAYJYDFW-UHFFFAOYSA-N

SMILES: [Se](C)C1=C(C(C)=O)C=CC=C1

Synonyms:

• 1-(2-Methylselanylphenyl)ethanone
• 1-[2-(Methylseleno)phenyl]ethanone
• Ethanone, 1-[2-(methylseleno)phenyl]-
• Acetophenone, 2′-(methylselenyl)-

Ethanone, 1-[2-(methylseleno)phenyl]-

CAS: 1441-98-1

Formula: C₉H₁₀OSe

Molecular weight: 213.1351

Ref: IN-DA001IY4