CymitQuimica logo

CAS 144100-10-7

:

2,4,6-Octadecatrienoic acid, ethyl ester, (E,E,E)-

Description:
2,4,6-Octadecatrienoic acid, ethyl ester, commonly referred to as ethyl linoleate, is an unsaturated fatty acid ester characterized by its long carbon chain and multiple double bonds. Specifically, it contains three cis double bonds located at the 2, 4, and 6 positions of the carbon chain, which contributes to its reactivity and fluidity. This compound is typically a colorless to pale yellow liquid with a characteristic fatty odor. It is soluble in organic solvents but has limited solubility in water due to its hydrophobic nature. The presence of multiple double bonds makes it susceptible to oxidation, which can affect its stability and shelf life. Ethyl octadecatrienoate is often used in food, cosmetics, and pharmaceutical applications due to its potential health benefits, including anti-inflammatory properties and its role as a source of essential fatty acids. Additionally, it can serve as a precursor in the synthesis of various bioactive compounds. Proper storage conditions are essential to maintain its quality and prevent degradation.
Formula:C20H34O2
InChI:InChI=1S/C20H34O2/c1-3-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20(21)22-4-2/h14-19H,3-13H2,1-2H3/b15-14+,17-16+,19-18+
InChI key:InChIKey=YQENMVNHTDPKOC-CJBMEHDJSA-N
SMILES:C(\C=C\C=C\CCCCCCCCCCC)=C/C(OCC)=O
Synonyms:
  • 2,4,6-Octadecatrienoic acid, ethyl ester, (E,E,E)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.