
CAS 144118-18-3
:β-D-Glucopyranosyl (3β)-3-[(O-β-D-glucopyranosyl-(1→3)-O-[β-D-xylopyranosyl-(1→2)]-α-L-arabinopyranosyl)oxy]olean-12-en-28-oate
Description:
The chemical substance known as β-D-Glucopyranosyl (3β)-3-[(O-β-D-glucopyranosyl-(1→3)-O-[β-D-xylopyranosyl-(1→2)]-α-L-arabinopyranosyl)oxy]olean-12-en-28-oate, with the CAS number 144118-18-3, is a complex glycoside derived from oleanolic acid. This compound features a triterpenoid backbone, characterized by a pentacyclic structure typical of oleanane-type compounds. Its structure includes multiple sugar moieties, specifically glucopyranosyl, xylopyranosyl, and arabinopyranosyl units, which contribute to its solubility and biological activity. The presence of these sugar units suggests potential interactions with biological systems, possibly influencing its pharmacological properties. The compound may exhibit various biological activities, including anti-inflammatory, antioxidant, or antimicrobial effects, which are common among glycosides. Its intricate structure and the presence of multiple functional groups may also affect its stability and reactivity. Overall, this substance represents a fascinating area of study in natural product chemistry, particularly in the context of medicinal chemistry and the development of therapeutic agents.
Formula:C52H84O21
InChI:InChI=1S/C52H84O21/c1-47(2)14-16-52(46(65)73-44-39(64)36(61)34(59)28(20-54)69-44)17-15-50(6)23(24(52)18-47)8-9-30-49(5)12-11-31(48(3,4)29(49)10-13-51(30,50)7)70-45-41(72-42-37(62)32(57)25(55)21-66-42)40(26(56)22-67-45)71-43-38(63)35(60)33(58)27(19-53)68-43/h8,24-45,53-64H,9-22H2,1-7H3/t24-,25+,26-,27+,28+,29-,30+,31-,32-,33+,34+,35-,36-,37+,38+,39+,40-,41+,42-,43-,44-,45-,49-,50+,51+,52-/m0/s1
InChI key:InChIKey=MLIQJRVPWRKGIO-BPJZXJLTSA-N
SMILES:C(O[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O)(=O)[C@]23[C@](C=4[C@@](C)(CC2)[C@@]5(C)[C@](CC4)([C@]6(C)[C@@](CC5)(C(C)(C)[C@@H](O[C@H]7[C@H](O[C@H]8[C@H](O)[C@@H](O)[C@H](O)CO8)[C@@H](O[C@@H]9O[C@H](CO)[C@@H](O)[C@H](O)[C@H]9O)[C@@H](O)CO7)CC6)[H])[H])(CC(C)(C)CC3)[H]
Synonyms:- Tarasaponin VII
- Olean-12-en-28-oic acid, 3-[(O-β-D-glucopyranosyl-(1→3)-O-[β-D-xylopyranosyl-(1→2)]-α-L-arabinopyranosyl)oxy]-, β-D-glucopyranosyl ester, (3β)-
- Elatoside F
- β-D-Glucopyranosyl (3β)-3-[(O-β-D-glucopyranosyl-(1→3)-O-[β-D-xylopyranosyl-(1→2)]-α-L-arabinopyranosyl)oxy]olean-12-en-28-oate
- Caraganoside A
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
Elatoside F
CAS:Elatoside F is a natural product for research related to life sciences. The catalog number is TN5998 and the CAS number is 144118-18-3.Formula:C52H84O21Purity:98%Color and Shape:SolidMolecular weight:1045.223Elatoside F
CAS:Elatoside F is a bioactive saponin, which is a type of secondary metabolite derived from the Camellia japonica plant. This compound belongs to the larger class of glycosides, specifically cytotoxic triterpenoid saponins. The mode of action of Elatoside F involves its ability to interact with cell membranes, leading to increased membrane permeability and potential disruption of cellular functions. This mechanism underlies its cytotoxic properties, making it a compound of interest in cancer research.Formula:C52H84O21Purity:Min. 95%Molecular weight:1,045.2 g/mol

