CAS 14415-44-2
:6-AMINO-CHROMEN-2-ONE
Description:
6-Amino-chromen-2-one, also known as coumarin-3-carboxylic acid, is a chemical compound characterized by its chromenone structure, which features a benzopyran ring fused with a carbonyl group. This compound typically exhibits a pale yellow to white crystalline appearance and is soluble in organic solvents such as ethanol and dimethyl sulfoxide, but has limited solubility in water. The presence of the amino group at the 6-position enhances its reactivity, making it a versatile intermediate in organic synthesis and medicinal chemistry. 6-Amino-chromen-2-one is known for its potential biological activities, including anti-inflammatory, antioxidant, and antimicrobial properties, which have garnered interest in pharmaceutical research. Additionally, its structural features allow for various modifications, leading to the development of derivatives with enhanced biological efficacy. Safety data indicates that, like many organic compounds, it should be handled with care, as it may pose health risks upon exposure. Overall, 6-amino-chromen-2-one is a significant compound in both synthetic and medicinal chemistry contexts.
Formula:C9H7NO2
InChI:InChI=1/C9H7NO2/c10-7-2-3-8-6(5-7)1-4-9(11)12-8/h1-5H,10H2
SMILES:c1cc(=O)oc2ccc(cc12)N
Synonyms:- 6-Amino-1,2-Benzopyrone
- 2-oxo-2H-chromen-6-aminium chloride
- 6-amino-2H-chromen-2-one
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
2H-1-Benzopyran-2-one, 6-amino-
CAS:Formula:C9H7NO2Purity:98%Color and Shape:SolidMolecular weight:161.15746-Amino-2H-chromen-2-one
CAS:Formula:C9H7NO2Purity:>98.0%(T)(HPLC)Color and Shape:White to Yellow powder to crystalMolecular weight:161.166-Amino-2H-chromen-2-one
CAS:6-Amino-2H-chromen-2-one is a molecule that binds to the receptor and has been shown to have biological properties. It's photophysical phase transition temperature is 132 degrees Celsius. 6-Amino-2H-chromen-2-one has an intramolecular hydrogen bond, which can be seen in the nmr spectroscopic data. 6-Amino-2H-chromen-2-one also has an intermolecular hydrogen bond with a carbonyl group and coumarin derivatives.
Formula:C9H7NO2Purity:Min. 95%Molecular weight:161.16 g/mol




