CAS 144163-65-5

3-(2-THIAZOLYL)PROPIONIC ACID

Description:

3-(2-Thiazolyl)propionic acid is an organic compound characterized by its thiazole ring, which contributes to its unique chemical properties. This compound features a propionic acid moiety, indicating the presence of a carboxylic acid functional group, which imparts acidic characteristics. The thiazole ring, a five-membered heterocyclic structure containing sulfur and nitrogen, enhances the compound's potential for biological activity and reactivity. Typically, compounds like this may exhibit moderate solubility in polar solvents due to the presence of the carboxylic acid group, while the thiazole ring can participate in various chemical interactions, including hydrogen bonding and coordination with metal ions. The compound may also demonstrate potential applications in pharmaceuticals or agrochemicals, given the biological relevance of thiazole derivatives. Its molecular structure suggests that it could engage in various chemical reactions, such as esterification or amidation, making it a versatile building block in organic synthesis. Overall, 3-(2-thiazolyl)propionic acid is notable for its structural features that combine both acidic and heterocyclic characteristics.

Formula: C₆H₇NO₂S

InChI: InChI=1/C6H7NO2S/c8-6(9)2-1-5-7-3-4-10-5/h3-4H,1-2H2,(H,8,9)

SMILES: C(CC(=O)O)c1nccs1

Synonyms:

• 3-Thiazol-2-Yl-Propionic Acid
• 3-(2-Thiazolyl)Propoinic Acid
• 3-(1,3-Thiazol-2-Yl)Propanoic Acid

2-Thiazolepropanoic acid

CAS: 144163-65-5

Formula: C₆H₇NO₂S

Purity: 95%

Color and Shape: Solid

Molecular weight: 157.1903

Ref: IN-DA001J1F

3-(2-Thiazolyl)propionic acid

CAS: 144163-65-5

3-(2-Thiazolyl)propionic acid

Purity: 96%

Molecular weight: 157.19g/mol

Ref: 54-OR964201

3-(2-Thiazolyl)propionic acid

CAS: 144163-65-5

Formula: C₆H₇NO₂S

Purity: 96%

Color and Shape: Solid

Molecular weight: 157.19

Ref: 10-F011900

3-(2-Thiazolyl)propionic acid

CAS: 144163-65-5

Versatile small molecule scaffold

Formula: C₆H₇NO₂S

Purity: Min. 95%

Molecular weight: 157.19 g/mol

Ref: 3D-UFA16365