CAS 144167-50-0

5-BROMO-1H-BENZIMIDAZOLE-2-CARBOXYLIC ACID ETHYL ESTER

Description:

5-Bromo-1H-benzimidazole-2-carboxylic acid ethyl ester is a chemical compound characterized by its structural features, which include a benzimidazole core substituted with a bromine atom and an ethyl ester functional group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as stability and potential reactivity due to the presence of the carboxylic acid derivative. The bromine substitution can influence its electronic properties, making it useful in various chemical reactions, including nucleophilic substitutions. The ethyl ester group enhances its solubility in organic solvents, which is advantageous for applications in pharmaceuticals and agrochemicals. Additionally, compounds of this nature may exhibit biological activity, making them of interest in medicinal chemistry for the development of new therapeutic agents. Overall, 5-bromo-1H-benzimidazole-2-carboxylic acid ethyl ester is a versatile compound with potential applications in research and industry, particularly in the synthesis of more complex molecules.

Formula: C₁₀H₉BrN₂O₂

InChI: InChI=1/C10H9BrN2O2/c1-2-15-10(14)9-12-7-4-3-6(11)5-8(7)13-9/h3-5H,2H2,1H3,(H,12,13)

SMILES: CCOC(=O)c1[nH]c2ccc(cc2n1)Br

Synonyms:

• ethyl 5-bromo-1H-benzimidazole-2-carboxylate
• ethyl 5-bromobenzimidazole-2-carboxylate

1H-Benzimidazole-2-carboxylic acid, 6-bromo-, ethyl ester

CAS: 144167-50-0

Formula: C₁₀H₉BrN₂O₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 269.0947

Ref: IN-DA001J14

Ethyl 5-bromo-1H-benzo[d]imidazole-2-carboxylate

CAS: 144167-50-0

Ethyl 5-bromo-1H-benzo[d]imidazole-2-carboxylate

Purity: 98%

Molecular weight: 269.10g/mol

Ref: 54-OR73039

Ethyl 5-bromo-1H-benzo[d]imidazole-2-carboxylate

CAS: 144167-50-0

Formula: C₁₀H₉BrN₂O₂

Purity: 98%

Molecular weight: 269.098

Ref: 10-F329190