CAS 144189-73-1
:DOTAP methyl sulfate
Description:
DOTAP methyl sulfate, or 1,2-dioleoyl-3-trimethylammonium-propane methyl sulfate, is a cationic lipid commonly used in the field of molecular biology and biochemistry, particularly for gene delivery and liposome formulation. It is characterized by its amphiphilic nature, possessing both hydrophobic (the long hydrocarbon chains) and hydrophilic (the quaternary ammonium group) properties, which facilitate the formation of lipid bilayers and vesicles in aqueous environments. The presence of the methyl sulfate group enhances its solubility in water and contributes to its positive charge, which is crucial for interacting with negatively charged nucleic acids. DOTAP is known for its ability to efficiently encapsulate DNA or RNA, promoting cellular uptake through endocytosis. Additionally, it exhibits low toxicity and good biocompatibility, making it a favorable choice for therapeutic applications. However, its efficacy can be influenced by factors such as the lipid composition of the formulation and the method of delivery. Overall, DOTAP methyl sulfate is a versatile tool in the development of lipid-based drug delivery systems.
Formula:C42H80NO4·CH3O4S
InChI:InChI=1/C42H80NO4.CH4O4S/c1-6-8-10-12-14-16-18-20-22-24-26-28-30-32-34-36-41(44)46-39-40(38-43(3,4)5)47-42(45)37-35-33-31-29-27-25-23-21-19-17-15-13-11-9-7-2;1-5-6(2,3)4/h20-23,40H,6-19,24-39H2,1-5H3;1H3,(H,2,3,4)/q+1;/p-1/b22-20-,23-21-;
InChI key:InChIKey=RSMRWWHFJMENJH-LQDDAWAPNA-M
SMILES:C(OC(CCCCCCC/C=C\CCCCCCCC)=O)(COC(CCCCCCC/C=C\CCCCCCCC)=O)C[N+](C)(C)C.S(OC)(=O)(=O)[O-]
Synonyms:- 1-Propanaminium, N,N,N-trimethyl-2,3-bis[(1-oxo-9-octadecenyl)oxy]-, (Z,Z)-, methyl sulfate
- 1-Propanaminium, N,N,N-trimethyl-2,3-bis[[(9Z)-1-oxo-9-octadecen-1-yl]oxy]-, methyl sulfate (1:1)
- 1-Propanaminium, N,N,N-trimethyl-2,3-bis[[(9Z)-1-oxo-9-octadecenyl]oxy]-, methyl sulfate
- DOTAP Me sulfate
- DOTAP methosulfate
- DOTAP methyl sulfate
- N,N,N-trimethyl-2,3-bis[(9Z)-octadec-9-enoyloxy]propan-1-aminium methanesulfonate
- N-(2,3-Dioleoyloxy-1-propyl)trimethylammonium methyl sulfate
- N-[1-(2,3-Dioleoyloxy)propyl]-N,N,N-trimethylammonium methyl sulfate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
DOTAP Methyl Sulfate
CAS:Formula:C43H83NO8SPurity:>95.0%(qNMR)Color and Shape:White to Light yellow powder to crystalMolecular weight:774.20N-[1-(2,3-Dioleoyloxy)propyl]-n,n,n-trimethylammonium methyl-sulfate
CAS:Dioleoyloxypropyl-N,N,N-trimethylammonium methylsulfate (DOTAP) is an antibacterial agent that disrupts the bacterial membrane. It has been shown to inhibit the uptake of chlamydia by inhibiting the binding of chlamydia to cells and enhancing the detection of chlamydia in cells. DOTAP also has pharmacological properties that are related to its ability to interfere with cellular membranes. DOTAP can be used as a strategy for developing antibacterial agents because it inhibits bacterial growth by disrupting their cellular membranes. This results in a decrease in phosphatidylethanolamine levels, leading to increased cell death.Formula:C43H83NO7SPurity:Min. 95%Molecular weight:758.19 g/mol




