CymitQuimica logo

CAS 144223-32-5

:

1H-Benzotriazol-1-yl-1H-pyrrol-2-ylmethanone

Description:
1H-Benzotriazol-1-yl-1H-pyrrol-2-ylmethanone, with the CAS number 144223-32-5, is a chemical compound that features a benzotriazole moiety and a pyrrole ring, indicating its potential applications in various fields such as materials science and organic synthesis. This compound is characterized by its heterocyclic structure, which contributes to its stability and reactivity. The presence of the benzotriazole group often imparts UV-absorbing properties, making it useful in photostabilizers and anti-corrosion agents. Additionally, the pyrrole component can enhance its electronic properties, potentially allowing for applications in organic electronics or as a ligand in coordination chemistry. The compound may exhibit biological activity, although specific pharmacological properties would require further investigation. Its solubility, melting point, and other physical properties would depend on the specific conditions and solvent used. Overall, 1H-Benzotriazol-1-yl-1H-pyrrol-2-ylmethanone represents a versatile structure with potential utility in both industrial and research applications.
Formula:C11H8N4O
InChI:InChI=1S/C11H8N4O/c16-11(9-5-3-7-12-9)15-10-6-2-1-4-8(10)13-14-15/h1-7,12H
InChI key:InChIKey=JDNIHKCPHBBAHS-UHFFFAOYSA-N
SMILES:C(=O)(N1C=2C(N=N1)=CC=CC2)C3=CC=CN3
Synonyms:
  • 1-(1H-Pyrrol-2-Ylcarbonyl)-1H-Benzotriazole
  • 1H-Benzotriazol-1-yl-1H-pyrrol-2-ylmethanone
  • 1H-Benzotriazole, 1-(1H-pyrrol-2-ylcarbonyl)-
  • Methanone, 1H-benzotriazol-1-yl-1H-pyrrol-2-yl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.