CymitQuimica logo

CAS 144223-33-6

:

1-(2-Furoyl)benzotriazole

Description:
1-(2-Furoyl)benzotriazole is an organic compound characterized by its unique structure, which combines a furoyl group with a benzotriazole moiety. This compound typically exhibits properties such as good solubility in organic solvents and moderate stability under standard conditions. It is known for its potential applications in various fields, including as a UV absorber and in photostabilization processes due to its ability to absorb ultraviolet light. The presence of the furoyl group contributes to its reactivity and interaction with other chemical species, making it useful in synthetic organic chemistry. Additionally, benzotriazole derivatives are often recognized for their corrosion inhibition properties, particularly in metal protection applications. The compound's molecular structure allows for various functionalization possibilities, which can enhance its utility in different chemical contexts. Overall, 1-(2-Furoyl)benzotriazole is a versatile compound with significant relevance in materials science and organic synthesis.
Formula:C11H7N3O2
InChI:InChI=1S/C11H7N3O2/c15-11(10-6-3-7-16-10)14-9-5-2-1-4-8(9)12-13-14/h1-7H
InChI key:InChIKey=AFORMRZDGRLVBW-UHFFFAOYSA-N
SMILES:C(=O)(N1C=2C(N=N1)=CC=CC2)C3=CC=CO3
Synonyms:
  • 1H-Benzotriazole, 1-(2-furanylcarbonyl)-
  • Methanone, 1H-benzotriazol-1-yl-2-furanyl-
  • 1H-Benzotriazol-1-yl-2-furanylmethanone
  • 1-(2-Furoyl)benzotriazole
  • 1-(2-Furanylcarbonyl)-1H-benzotriazole
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.