CAS 14425-64-0
:1-(2-Bromoethyl)-4-methoxybenzene
Description:
1-(2-Bromoethyl)-4-methoxybenzene, also known as p-methoxyphenethyl bromide, is an organic compound characterized by its aromatic structure and the presence of both a bromine atom and a methoxy group. The compound features a benzene ring substituted with a methoxy group at the para position and a bromoethyl group at the 1-position. This substitution pattern contributes to its reactivity and potential applications in organic synthesis, particularly in the formation of carbon-carbon bonds. The bromine atom serves as a good leaving group, making it useful in nucleophilic substitution reactions. The methoxy group can influence the electronic properties of the molecule, enhancing its reactivity in electrophilic aromatic substitution reactions. In terms of physical properties, it is typically a colorless to pale yellow liquid with moderate solubility in organic solvents. Safety considerations should be taken into account due to the presence of bromine, which can be hazardous. Overall, this compound is of interest in medicinal chemistry and materials science for its potential utility in synthesizing more complex organic molecules.
Formula:C9H11BrO
InChI:InChI=1S/C9H11BrO/c1-11-9-4-2-8(3-5-9)6-7-10/h2-5H,6-7H2,1H3
InChI key:InChIKey=OXHPTABOQVHKLN-UHFFFAOYSA-N
SMILES:C(CBr)C1=CC=C(OC)C=C1
Synonyms:- Anisole, p-(2-bromoethyl)-
- 1-(2-Bromoethyl)-4-methoxybenzene
- p-Methoxyphenethyl bromide
- Benzene, 1-(2-bromoethyl)-4-methoxy-
- 4-Methoxyphenethyl bromide
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Benzene, 1-(2-bromoethyl)-4-methoxy-
CAS:Formula:C9H11BrOPurity:98%Color and Shape:LiquidMolecular weight:215.08702-(4-Methoxyphenyl)ethyl bromide
CAS:2-(4-Methoxyphenyl)ethyl bromidePurity:98%Molecular weight:215.09g/mol2-(4-Methoxyphenyl)ethyl bromide
CAS:2-(4-Methoxyphenyl)ethyl bromide is an adenosine receptor antagonist that can be used in cancer treatment. It has been shown to inhibit the growth of cancer cells by blocking the binding of adenosine to its receptors and inhibiting phosphodiesterase, which is an enzyme that breaks down the key cellular messenger, cyclic AMP (cAMP). 2-(4-Methoxyphenyl)ethyl bromide also inhibits the production of aphanorphine, a morphine analogue that has been shown to stimulate endoplasmic reticulum stress and apoptosis in cancer cells. This compound has been synthesised and tested on animal models with promising results.Formula:C9H11BrOPurity:Min. 95%Molecular weight:215.09 g/mol



