CAS 144261-14-3
:1-(3,5-Difluorophenyl)-4-pentylcyclohexanol
Description:
1-(3,5-Difluorophenyl)-4-pentylcyclohexanol, with the CAS number 144261-14-3, is a chemical compound characterized by its unique structure that includes a cyclohexanol ring substituted with a pentyl group and a 3,5-difluorophenyl moiety. This compound is likely to exhibit properties typical of alcohols, such as the ability to form hydrogen bonds, which can influence its solubility in polar solvents. The presence of fluorine atoms in the phenyl ring may impart distinct electronic and steric effects, potentially affecting its reactivity and interaction with biological systems. The pentyl group contributes to the hydrophobic character of the molecule, which can influence its partitioning behavior in various environments. Additionally, the compound may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry. Overall, its unique combination of functional groups suggests potential applications in various fields, including pharmaceuticals and materials science, although specific biological activity and stability would require further investigation.
Formula:C17H24F2O
InChI:InChI=1S/C17H24F2O/c1-2-3-4-5-13-6-8-17(20,9-7-13)14-10-15(18)12-16(19)11-14/h10-13,20H,2-9H2,1H3
InChI key:InChIKey=ZSBUAXUNEYLYCB-UHFFFAOYSA-N
SMILES:OC1(CCC(CCCCC)CC1)C2=CC(F)=CC(F)=C2
Synonyms:- Cyclohexanol, 1-(3,5-difluorophenyl)-4-pentyl-
- 1-(3,5-Difluorophenyl)-4-pentylcyclohexanol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
