CymitQuimica logo

CAS 144294-43-9

:

3-Pyridazinamine,5-methyl-

Description:
3-Pyridazinamine, 5-methyl- is an organic compound characterized by its pyridazine ring structure, which is a six-membered aromatic heterocycle containing two nitrogen atoms at positions 1 and 2. This compound features an amino group (-NH2) at the 3-position and a methyl group (-CH3) at the 5-position of the pyridazine ring, contributing to its chemical reactivity and potential biological activity. It is typically a solid at room temperature and may exhibit solubility in polar solvents due to the presence of the amino group. The compound's structure suggests potential applications in pharmaceuticals, particularly in the development of drugs targeting various biological pathways. Its properties, such as melting point, boiling point, and reactivity, can vary based on the specific conditions and the presence of other functional groups. As with many nitrogen-containing heterocycles, 3-Pyridazinamine, 5-methyl- may also participate in various chemical reactions, including nucleophilic substitutions and coupling reactions, making it of interest in synthetic organic chemistry.
Formula:C5H7N3
InChI:InChI=1S/C5H7N3/c1-4-2-5(6)8-7-3-4/h2-3H,1H3,(H2,6,8)
InChI key:NDPKVJZZCMFBIO-UHFFFAOYSA-N
SMILES:CC1=CC(=NN=C1)N
Synonyms:
  • 5-Methylpyridazin-3-amine
Found 4 products.