CAS 1443-76-1
:4-Hydroxy-3,5-dimethoxybenzoic acid hydrazide
Description:
4-Hydroxy-3,5-dimethoxybenzoic acid hydrazide, with the CAS number 1443-76-1, is a chemical compound that belongs to the class of hydrazides, which are derivatives of hydrazine. This substance features a benzoic acid core with hydroxyl and methoxy substituents, contributing to its unique chemical properties. The presence of the hydrazide functional group indicates that it can participate in various chemical reactions, including condensation and acylation. It is typically characterized by its solid state at room temperature and may exhibit moderate solubility in polar solvents due to the presence of hydroxyl and methoxy groups. The compound may also display biological activity, making it of interest in pharmaceutical research. Its structural features suggest potential applications in medicinal chemistry, particularly in the development of new therapeutic agents. As with many organic compounds, safety and handling precautions should be observed, as the specific toxicity and reactivity profiles can vary.
Formula:C9H12N2O4
InChI:InChI=1S/C9H12N2O4/c1-14-6-3-5(9(13)11-10)4-7(15-2)8(6)12/h3-4,12H,10H2,1-2H3,(H,11,13)
InChI key:InChIKey=AKZAAANGIPRVDU-UHFFFAOYSA-N
SMILES:C(NN)(=O)C1=CC(OC)=C(O)C(OC)=C1
Synonyms:- 3,5-Dimethoxy-4-hydroxybenzoic acid hydrazide
- 4-Hydroxy-3,5-dimethoxybenzohydrazide
- 4-Hydroxy-3,5-dimethoxybenzoic acid hydrazide
- Benzoic acid, 4-hydroxy-3,5-dimethoxy-, hydrazide
- NSC 77902
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Benzoic acid, 4-hydroxy-3,5-dimethoxy-, hydrazide
CAS:Formula:C9H12N2O4Purity:96%Color and Shape:SolidMolecular weight:212.20263,5-Dimethoxy-4-hydroxybenzhydrazide
CAS:3,5-Dimethoxy-4-hydroxybenzhydrazide
Molecular weight:212.20258g/molSyringic acid hydrazide
CAS:Syringic acid hydrazide is a heterocyclic molecule with anticancer activity. It has been shown to inhibit the growth of cancer cells, both in vitro and in vivo. Syringic acid hydrazide is a chlorinating agent that reacts with p-hydroxybenzoic acid to form an intermediate that binds to active site residues on the cancer cell's DNA. This binding prevents the synthesis of DNA, leading to cell death. Syringic acid hydrazide does not affect uninfected plants or cultivars resistant to Fusarium oxysporum f., as it does not bind to their chlorophyll molecules.
Formula:C9H12N2O4Purity:Min. 95%Color and Shape:PowderMolecular weight:212.2 g/mol3,5-Dimethoxy-4-hydroxybenzhydrazide
CAS:Formula:C9H12N2O4Purity:95%Color and Shape:SolidMolecular weight:212.205




