CAS 14430-23-0
:5,6-Dimethoxyindole
Description:
5,6-Dimethoxyindole is an organic compound characterized by its indole structure, which consists of a fused benzene and pyrrole ring. The presence of two methoxy groups (-OCH3) at the 5 and 6 positions of the indole ring significantly influences its chemical properties and reactivity. This compound is typically a white to off-white solid and is soluble in organic solvents such as ethanol and dichloromethane, but has limited solubility in water. 5,6-Dimethoxyindole is of interest in various fields, including medicinal chemistry and materials science, due to its potential biological activities and applications in synthesizing other complex molecules. Its derivatives may exhibit various pharmacological effects, making it a subject of research in drug development. Additionally, the methoxy substituents can enhance the compound's stability and alter its electronic properties, which can be crucial for its reactivity in chemical reactions. As with many indole derivatives, it may also participate in various electrophilic substitution reactions, making it a versatile building block in organic synthesis.
Formula:C10H11NO2
InChI:InChI=1S/C10H11NO2/c1-12-9-5-7-3-4-11-8(7)6-10(9)13-2/h3-6,11H,1-2H3
InChI key:InChIKey=QODBZRNBPUPLEZ-UHFFFAOYSA-N
SMILES:O(C)C=1C=C2C(=CC1OC)NC=C2
Synonyms:- 1H-Indole, 5,6-dimethoxy-
- 5,6-Dimethoxy-1H-indole
- 5,6-Methoxyindole
- Indole, 5,6-dimethoxy-
- 5,6-Dimethoxyindole
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
5,6-Dimethoxyindole, 98%
CAS:It is applied as a reactant in synthesis of indolylhydroxyoxindoles via enantioselective Friedel-Crafts reaction, in synthesis of benzyl trimethoxyindoles, for synthesis of benzoylpiperazinyl-indolyl ethane dione derivatives as HIV-1 inhibitors, for synthesis of 1-aroylindole 3-aroylindoles combretaFormula:C10H11NO2Purity:98%Color and Shape:White to pale cream, Crystals or powder or crystalline powderMolecular weight:177.201H-Indole, 5,6-dimethoxy-
CAS:Formula:C10H11NO2Purity:97%Color and Shape:SolidMolecular weight:177.19985,6-Dimethoxy-1H-indole
CAS:5,6-Dimethoxy-1H-indolePurity:98%Color and Shape:SolidMolecular weight:177.20g/mol5,6-Dimethoxyindole
CAS:Formula:C10H11NO2Purity:>98.0%(GC)Color and Shape:White to Light gray to Light orange powder to crystalMolecular weight:177.205,6-Dimethoxyindole
CAS:Formula:C10H11NO2Purity:97%Color and Shape:Solid, CrystallineMolecular weight:177.203





