CAS 144301-84-8
:Methyl-2-deoxy-alpha-L-erythro-pentofuranose
Description:
Methyl-2-deoxy-alpha-L-erythro-pentofuranose is a carbohydrate derivative, specifically a methylated form of a pentose sugar. It is characterized by its five-carbon sugar backbone, which is a furanose form, indicating a cyclic structure that includes a five-membered ring. The "2-deoxy" designation signifies that it lacks a hydroxyl group at the second carbon, which is a common modification in sugars that can influence their biological activity and reactivity. The "alpha" configuration refers to the orientation of the hydroxyl group on the anomeric carbon, which affects the sugar's properties and interactions. This compound is typically used in biochemical research and synthesis, particularly in the study of nucleosides and nucleotides, as it can serve as a building block for more complex molecules. Its methylation can enhance lipophilicity and stability, making it useful in various applications, including drug design and development. Overall, Methyl-2-deoxy-alpha-L-erythro-pentofuranose is an important compound in the field of organic and medicinal chemistry.
Formula:C6H12O4
InChI:InChI=1/C6H12O4/c1-9-6-2-4(8)5(3-7)10-6/h4-8H,2-3H2,1H3/t4-,5+,6-/m1/s1
Synonyms:- Methyl-2-Deoxy-α-L-erythro-pentofuranose
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Methyl 2-deoxy-a-L-ribofuranoside
CAS:Methyl 2-deoxy-a-L-ribofuranoside is a modification of a monosaccharide. It is synthesized by reacting 2,3,4,6-tetra-O-methylglucose with sodium nitrite in the presence of hydrochloric acid. Methyl 2-deoxy-a-L-ribofuranoside is used to modify saccharides and polysaccharides.Formula:C6H12O4Purity:Min. 95%Molecular weight:148.16 g/mol


