CAS 1443112-44-4
:B-1,5-Naphthyridin-3-ylboronic acid
Description:
B-1,5-Naphthyridin-3-ylboronic acid is an organic compound characterized by the presence of a naphthyridine moiety and a boronic acid functional group. The naphthyridine structure contributes to its aromatic properties, which can influence its reactivity and interactions with other molecules. The boronic acid group is known for its ability to form reversible covalent bonds with diols, making it useful in various applications, including drug development and materials science. This compound may exhibit properties such as moderate solubility in polar solvents and potential biological activity, which can be explored in medicinal chemistry. Additionally, its structural features may allow for participation in Suzuki coupling reactions, a common method for forming carbon-carbon bonds in organic synthesis. Overall, B-1,5-Naphthyridin-3-ylboronic acid is a versatile compound with potential applications in both synthetic and pharmaceutical chemistry, although specific characteristics such as melting point, boiling point, and spectral data would require further investigation or experimental determination.
Formula:C8H7BN2O2
InChI:InChI=1S/C8H7BN2O2/c12-9(13)6-4-8-7(11-5-6)2-1-3-10-8/h1-5,12-13H
InChI key:InChIKey=HQRZMWFPSGZGSQ-UHFFFAOYSA-N
SMILES:B(O)(O)C1=CC2=C(N=C1)C=CC=N2
Synonyms:- B-(1,5-Naphthyridin-3-ylmethyl)boronic acid
- [1,5]Naphthyridine-3-boronic acid
- B-1,5-Naphthyridin-3-ylboronic acid
- Boronic acid, B-1,5-naphthyridin-3-yl-
- 1,5-Naphthyridin-3-ylboronic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.