CAS 14432-09-8

1-deazaadenosine

Description:

1-Deazaadenosine is a modified nucleoside that is structurally similar to adenosine, with the key difference being the absence of one nitrogen atom in the purine ring. This modification can influence its biological activity and interactions with enzymes and receptors. The compound is often studied for its potential roles in biochemical pathways, particularly in relation to nucleic acid metabolism and cellular signaling. It exhibits properties typical of nucleosides, such as solubility in water and the ability to participate in hydrogen bonding due to its hydroxyl and amino groups. 1-Deazaadenosine can act as a substrate or inhibitor for various enzymes, making it of interest in pharmacological research. Its unique structure allows it to mimic adenosine while potentially altering the pharmacodynamics and pharmacokinetics of related compounds. Overall, 1-deazaadenosine serves as a valuable tool in the study of nucleoside function and the development of therapeutic agents targeting adenosine pathways.

Formula: C₁₁H₁₄N₄O₄

InChI: InChI=1/C11H14N4O4/c12-5-1-2-13-10-7(5)14-4-15(10)11-9(18)8(17)6(3-16)19-11/h1-2,4,6,8-9,11,16-18H,3H2,(H2,12,13)/t6-,8-,9-,11-/m1/s1

SMILES: c1cnc2c(c1N)ncn2[C@H]1[C@@H]([C@@H]([C@@H](CO)O1)O)O

Synonyms:

• 3H-Imidazo(4,5-b)pyridin-7-amine, 3-beta-D-ribofuranosyl-
• 3-(beta-D-ribofuranosyl)-3H-imidazo[4,5-b]pyridin-7-amine
• 1-Deazaadenosine

3H-Imidazo[4,5-b]pyridin-7-amine, 3-β-D-ribofuranosyl-

CAS: 14432-09-8

Formula: C₁₁H₁₄N₄O₄

Purity: 98.0%

Color and Shape: Solid

Molecular weight: 266.2533

Ref: IN-DA001JBZ

1-Deazaadenosine

CAS: 14432-09-8

1-Deazaadenosine is a nitro compound that binds to adenosine receptors and has antiviral activity. It inhibits the growth of herpes simplex virus and lymphoproliferative disorders, which are caused by adenosine receptor subtypes. 1-Deazaadenosine also binds to the hydrogen bond between the amine group of adenosine and the hydroxyl group of water, forming an intramolecular hydrogen bond. This binding prevents the formation of hydrogen bonds with other molecules, preventing them from being broken down by enzymes such as adenosine kinase.

Formula: C₁₁H₁₄N₄O₄

Purity: Min. 98 Area-%

Color and Shape: Powder

Molecular weight: 266.25 g/mol

Ref: 3D-PAA43209

1-Deazaadenosine

CAS: 14432-09-8

1-Deazaadenosine, an adenosine deaminase inhibitor (Ki: 0.66 μM), may treat cancer, particularly lymphoproliferative disorders.

Formula: C₁₁H₁₄N₄O₄

Purity: 98%

Color and Shape: Solid

Molecular weight: 266.25

Ref: TM-T10015