CAS 144320-18-3
:2-(3-chlorophenyl)-4-methylsulfanyl-6-[3-(trifluoromethyl)phenyl]pyrid ine
Description:
2-(3-Chlorophenyl)-4-methylsulfanyl-6-[3-(trifluoromethyl)phenyl]pyridine, with the CAS number 144320-18-3, is a chemical compound that belongs to the class of pyridine derivatives. This compound features a pyridine ring substituted with various functional groups, including a chlorophenyl group and a trifluoromethylphenyl group, which contribute to its unique chemical properties. The presence of the methylsulfanyl group enhances its potential for biological activity, making it of interest in medicinal chemistry. The trifluoromethyl group is known for imparting lipophilicity and can influence the compound's pharmacokinetic properties. Additionally, the chlorophenyl moiety may enhance the compound's reactivity and interaction with biological targets. Overall, this compound's structural characteristics suggest potential applications in pharmaceuticals, particularly in the development of new therapeutic agents. However, specific properties such as solubility, melting point, and reactivity would require empirical data for precise characterization.
Formula:C19H13ClF3NS
InChI:InChI=1/C19H13ClF3NS/c1-25-16-10-17(12-4-2-6-14(8-12)19(21,22)23)24-18(11-16)13-5-3-7-15(20)9-13/h2-11H,1H3
SMILES:CSc1cc(c2cccc(c2)C(F)(F)F)nc(c1)c1cccc(c1)Cl
Synonyms:- Pyridine, 2-(3-chlorophenyl)-4-(methylthio)-6-(3-(trifluoromethyl)phenyl)-
- 2-(3-Chlorophenyl)-4-(methylthio)-6-(3-(trifluoromethyl)phenyl)Pyridine
- 2-(3-Chlorophenyl)-4-(Methylsulfanyl)-6-[3-(Trifluoromethyl)Phenyl]Pyridine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Pyridine, 2-(3-chlorophenyl)-4-(methylthio)-6-[3-(trifluoromethyl)phenyl]-
CAS:Formula:C19H13ClF3NSMolecular weight:379.8264
