CAS 1443288-75-2

5-Bromo-2-methyl-6-(4-morpholinyl)-3-pyridinecarboxylic acid

Description:

5-Bromo-2-methyl-6-(4-morpholinyl)-3-pyridinecarboxylic acid is a chemical compound characterized by its complex structure, which includes a pyridine ring substituted with a bromine atom, a methyl group, and a morpholine moiety. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, including potential solubility in polar solvents due to the presence of the carboxylic acid functional group. The bromine substituent can influence its reactivity, making it a candidate for various chemical reactions, such as nucleophilic substitutions. The morpholine group may enhance its biological activity, potentially contributing to its pharmacological properties. As a pyridinecarboxylic acid derivative, it may also exhibit acidic behavior, allowing it to participate in acid-base reactions. Overall, this compound's unique structural features suggest potential applications in medicinal chemistry, particularly in the development of pharmaceuticals or agrochemicals. However, specific physical and chemical properties such as melting point, boiling point, and spectral data would require experimental determination or literature reference for precise characterization.

Formula: C₁₁H₁₃BrN₂O₃

InChI: InChI=1S/C11H13BrN2O3/c1-7-8(11(15)16)6-9(12)10(13-7)14-2-4-17-5-3-14/h6H,2-5H2,1H3,(H,15,16)

InChI key: InChIKey=UVUJAVRCNMDJRB-UHFFFAOYSA-N

SMILES: BrC1=C(N=C(C)C(C(O)=O)=C1)N2CCOCC2

Synonyms:

• 5-Bromo-2-methyl-6-(4-morpholinyl)-3-pyridinecarboxylic acid
• 3-Pyridinecarboxylic acid, 5-bromo-2-methyl-6-(4-morpholinyl)-