CymitQuimica logo

CAS 1443291-25-5

:

1-[1-[(4-Chlorophenyl)methyl]-1H-1,2,3-triazol-4-yl]ethanone

Description:
1-[1-[(4-Chlorophenyl)methyl]-1H-1,2,3-triazol-4-yl]ethanone, with the CAS number 1443291-25-5, is a chemical compound characterized by its unique triazole ring structure, which contributes to its potential biological activity. The presence of the 4-chlorophenyl group enhances its lipophilicity, potentially influencing its interaction with biological targets. This compound typically exhibits properties such as moderate solubility in organic solvents and limited solubility in water, which is common for many triazole derivatives. Its structure suggests potential applications in medicinal chemistry, particularly in the development of antifungal or antimicrobial agents, owing to the triazole moiety's known efficacy in these areas. Additionally, the compound may exhibit interesting pharmacological properties, making it a subject of interest for further research in drug development. Safety and handling precautions should be observed, as with any chemical substance, due to potential toxicity or reactivity. Overall, this compound represents a class of triazole derivatives that are valuable in both synthetic and medicinal chemistry.
Formula:C11H10ClN3O
InChI:InChI=1S/C11H10ClN3O/c1-8(16)11-7-15(14-13-11)6-9-2-4-10(12)5-3-9/h2-5,7H,6H2,1H3
InChI key:InChIKey=SRBRNDCAHLWKTL-UHFFFAOYSA-N
SMILES:C(N1C=C(C(C)=O)N=N1)C2=CC=C(Cl)C=C2
Synonyms:
  • 1-[1-[(4-Chlorophenyl)methyl]-1H-1,2,3-triazol-4-yl]ethan-1-one
  • 1-[1-[(4-Chlorophenyl)methyl]-1H-1,2,3-triazol-4-yl]ethanone
  • 1-[1-[(4-Chlorophenyl)methyl]triazol-4-yl]ethanone
  • Ethanone, 1-[1-[(4-chlorophenyl)methyl]-1H-1,2,3-triazol-4-yl]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.