CAS 1443304-64-0

Benzaldehyde, 4-methyl-3-(pentyloxy)-

Description:

Benzaldehyde, 4-methyl-3-(pentyloxy)- is an organic compound characterized by its aromatic structure, which includes a benzene ring substituted with a formyl group (–CHO) and a pentyloxy group (–O-C5H11) at specific positions. This compound features a methyl group (–CH3) at the para position relative to the formyl group, contributing to its unique chemical properties. It is typically a colorless to pale yellow liquid with a pleasant almond-like odor, characteristic of benzaldehyde derivatives. The presence of the pentyloxy group enhances its solubility in organic solvents and may influence its reactivity, particularly in nucleophilic substitution reactions. The compound's molecular structure suggests potential applications in the synthesis of fragrances, flavoring agents, and as an intermediate in organic synthesis. Additionally, its physical properties, such as boiling point and density, are influenced by the molecular weight and the nature of the substituents. As with many aromatic compounds, it may exhibit moderate toxicity and should be handled with appropriate safety precautions.

Formula: C₁₃H₁₈O₂

InChI: InChI=1S/C13H18O2/c1-3-4-5-8-15-13-9-12(10-14)7-6-11(13)2/h6-7,9-10H,3-5,8H2,1-2H3

InChI key: InChIKey=YUMBFMIRBUEXKO-UHFFFAOYSA-N

SMILES: O(CCCCC)C1=CC(C=O)=CC=C1C

Synonyms:

• Benzaldehyde, 4-methyl-3-(pentyloxy)-