CymitQuimica logo

CAS 1443305-66-5

:

4-Fluoro-1-(methylthio)-2-propoxybenzene

Description:
4-Fluoro-1-(methylthio)-2-propoxybenzene is an organic compound characterized by its aromatic structure, which includes a fluorine atom and a methylthio group attached to a benzene ring. The presence of the propoxy group contributes to its solubility and reactivity. This compound is likely to exhibit moderate polarity due to the combination of the electronegative fluorine and the sulfur atom in the methylthio group. Its molecular structure suggests potential applications in pharmaceuticals or agrochemicals, where such functional groups can influence biological activity. The compound may also participate in various chemical reactions, including nucleophilic substitutions or electrophilic aromatic substitutions, due to the reactive sites provided by the functional groups. Additionally, its physical properties, such as boiling point and melting point, would be influenced by the molecular weight and the nature of the substituents. Safety and handling precautions should be observed, as with any chemical substance, particularly those containing halogens and sulfur.
Formula:C10H13FOS
InChI:InChI=1S/C10H13FOS/c1-3-6-12-9-7-8(11)4-5-10(9)13-2/h4-5,7H,3,6H2,1-2H3
InChI key:InChIKey=HSJSRWMVCRMQPW-UHFFFAOYSA-N
SMILES:O(CCC)C1=C(SC)C=CC(F)=C1
Synonyms:
  • Benzene, 4-fluoro-1-(methylthio)-2-propoxy-
  • 4-Fluoro-1-(methylthio)-2-propoxybenzene
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.