CAS 1443306-09-9

3-Bromo-4′-ethyl-1,1′-biphenyl

Description:

3-Bromo-4′-ethyl-1,1′-biphenyl is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of a bromine atom at the 3-position of one phenyl ring and an ethyl group at the 4′-position of the other ring contributes to its unique chemical properties. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents due to its hydrophobic nature. It is likely to participate in electrophilic aromatic substitution reactions due to the electron-withdrawing effect of the bromine atom, which can influence the reactivity of the aromatic system. Additionally, the ethyl group can provide steric hindrance, affecting the orientation and rate of substitution reactions. As with many brominated compounds, it may have implications in environmental chemistry and toxicology, necessitating careful handling and consideration of its potential effects. Overall, 3-Bromo-4′-ethyl-1,1′-biphenyl serves as a valuable compound in organic synthesis and materials science.

Formula: C₁₄H₁₃Br

InChI: InChI=1S/C14H13Br/c1-2-11-6-8-12(9-7-11)13-4-3-5-14(15)10-13/h3-10H,2H2,1H3

InChI key: InChIKey=PFXOGSZPPHEYBD-UHFFFAOYSA-N

SMILES: BrC=1C=C(C=CC1)C2=CC=C(CC)C=C2

Synonyms:

• 1,1′-Biphenyl, 3-bromo-4′-ethyl-
• 3-Bromo-4′-ethyl-1,1′-biphenyl