CymitQuimica logo

CAS 1443306-85-1

:

Methyl 4-fluoro-β-methyl-δ-oxobenzenepentanoate

Description:
Methyl 4-fluoro-β-methyl-δ-oxobenzenepentanoate, identified by its CAS number 1443306-85-1, is a chemical compound characterized by its complex structure, which includes a methyl ester functional group, a fluorine atom, and a ketone moiety. This compound belongs to the class of benzenepentanoates, indicating that it features a pentanoate chain attached to a benzene ring. The presence of the fluorine atom suggests potential applications in pharmaceuticals or agrochemicals, as fluorinated compounds often exhibit enhanced biological activity or stability. The β-methyl and δ-oxo groups contribute to its reactivity and may influence its physical properties, such as solubility and boiling point. Methyl esters are generally known for their pleasant odors and are often used in flavoring and fragrance applications. The specific characteristics, such as melting point, boiling point, and solubility, would depend on the molecular interactions and the overall structure of the compound. Further studies would be necessary to fully elucidate its properties and potential applications in various fields.
Formula:C13H15FO3
InChI:InChI=1S/C13H15FO3/c1-9(8-13(16)17-2)7-12(15)10-3-5-11(14)6-4-10/h3-6,9H,7-8H2,1-2H3
InChI key:InChIKey=JULGJUBDLVCIHG-UHFFFAOYSA-N
SMILES:C(CC(CC(OC)=O)C)(=O)C1=CC=C(F)C=C1
Synonyms:
  • Benzenepentanoic acid, 4-fluoro-β-methyl-δ-oxo-, methyl ester
  • Methyl 5-(4-fluorophenyl)-3-methyl-5-oxopentanoate
  • Methyl 4-fluoro-β-methyl-δ-oxobenzenepentanoate
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.