CAS 1443327-09-0: α-Methyl-2-(1-methylethoxy)-α-(1-methylethyl)benzenemethanol

Description:α-Methyl-2-(1-methylethoxy)-α-(1-methylethyl)benzenemethanol, identified by its CAS number 1443327-09-0, is a chemical compound that belongs to the class of organic compounds known as alcohols. This substance features a complex structure characterized by a benzene ring substituted with multiple alkyl groups and an ether functional group. The presence of the α-methyl and isopropyl groups contributes to its hydrophobic nature, which can influence its solubility in various solvents. The compound may exhibit interesting properties such as moderate volatility and potential reactivity due to the hydroxyl (-OH) group, which can participate in hydrogen bonding. Its unique structure may also impart specific physical properties, such as boiling point and melting point, which are essential for applications in organic synthesis or as intermediates in chemical reactions. However, detailed information regarding its toxicity, environmental impact, and specific applications may require further investigation or empirical data.

Formula:C₁₄H₂₂O₂

InChI:InChI=1S/C14H22O2/c1-10(2)14(5,15)12-8-6-7-9-13(12)16-11(3)4/h6-11,15H,1-5H3

InChI key:InChIKey=YPSYLMCZEMQGMA-UHFFFAOYSA-N

SMILES:OC(C=1C=CC=CC1OC(C)C)(C)C(C)C

Synonyms:
Benzenemethanol, α-methyl-2-(1-methylethoxy)-α-(1-methylethyl)-
α-Methyl-2-(1-methylethoxy)-α-(1-methylethyl)benzenemethanol

There are currently no products for this CAS.