CAS 1443340-32-6
:1-[(Ethylthio)methyl]-2-methoxybenzene
Description:
1-[(Ethylthio)methyl]-2-methoxybenzene, identified by its CAS number 1443340-32-6, is an organic compound characterized by its aromatic structure, which includes a methoxy group (-OCH3) and an ethylthio group (-S-ethyl) attached to a benzene ring. This compound features a methyl group linked to the sulfur atom of the ethylthio group, contributing to its unique reactivity and properties. The presence of the methoxy group typically enhances the compound's solubility in organic solvents and can influence its electronic properties, making it a potential candidate for various chemical reactions. Additionally, the ethylthio moiety may impart specific characteristics such as increased lipophilicity and potential biological activity. The compound's synthesis and applications may be of interest in fields such as medicinal chemistry, materials science, or organic synthesis, where derivatives of methoxybenzene are often utilized. As with many organic compounds, safety and handling precautions should be observed due to potential toxicity or reactivity.
Formula:C10H14OS
InChI:InChI=1S/C10H14OS/c1-3-12-8-9-6-4-5-7-10(9)11-2/h4-7H,3,8H2,1-2H3
InChI key:InChIKey=XBQLXTJJSPIMOD-UHFFFAOYSA-N
SMILES:C(SCC)C1=C(OC)C=CC=C1
Synonyms:- Benzene, 1-[(ethylthio)methyl]-2-methoxy-
- 1-[(Ethylthio)methyl]-2-methoxybenzene
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
1-[(Ethylthio)methyl]-2-methoxybenzene
CAS:Controlled ProductFormula:C10H14OSColor and Shape:NeatMolecular weight:182.28
