CAS 1443344-82-8
:Ethyl 5-(2,3-difluorophenoxy)pentanoate
Description:
Ethyl 5-(2,3-difluorophenoxy)pentanoate is an organic compound characterized by its ester functional group, which is derived from the reaction of an alcohol (ethyl alcohol) and a carboxylic acid. This compound features a pentanoate chain, indicating a five-carbon backbone, and a phenoxy group that includes a difluorinated aromatic ring, specifically a 2,3-difluorophenyl moiety. The presence of fluorine atoms in the aromatic ring can significantly influence the compound's chemical properties, such as its polarity, reactivity, and potential biological activity. Ethyl 5-(2,3-difluorophenoxy)pentanoate may exhibit interesting characteristics such as moderate solubility in organic solvents and potential applications in pharmaceuticals or agrochemicals due to its unique structure. Its molecular interactions, stability, and reactivity can be further explored through various analytical techniques, including NMR spectroscopy and mass spectrometry, to understand its behavior in different chemical environments. As with any chemical substance, safety data and handling precautions should be considered when working with this compound.
Formula:C13H16F2O3
InChI:InChI=1S/C13H16F2O3/c1-2-17-12(16)8-3-4-9-18-11-7-5-6-10(14)13(11)15/h5-7H,2-4,8-9H2,1H3
InChI key:InChIKey=QNBZMVOWQPLFGM-UHFFFAOYSA-N
SMILES:O(CCCCC(OCC)=O)C1=C(F)C(F)=CC=C1
Synonyms:- Ethyl 5-(2,3-difluorophenoxy)pentanoate
- Pentanoic acid, 5-(2,3-difluorophenoxy)-, ethyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.