CAS 1443345-65-0

Ethyl 3-[2-chloro-4-(trifluoromethyl)phenoxy]propanoate

Description:

Ethyl 3-[2-chloro-4-(trifluoromethyl)phenoxy]propanoate is an organic compound characterized by its ester functional group, which is derived from propanoic acid and ethyl alcohol. The presence of a chloro group and a trifluoromethyl group on the aromatic ring contributes to its unique chemical properties, including increased lipophilicity and potential biological activity. This compound typically appears as a colorless to pale yellow liquid and is soluble in organic solvents. Its molecular structure suggests potential applications in agrochemicals, pharmaceuticals, or as an intermediate in organic synthesis. The trifluoromethyl group is known to enhance the metabolic stability of compounds, making them more resistant to degradation. Additionally, the chlorine atom can influence the compound's reactivity and interaction with biological systems. Safety data should be consulted for handling and exposure guidelines, as halogenated compounds can exhibit varying degrees of toxicity and environmental impact. Overall, this compound's unique functional groups and structure make it a subject of interest in various chemical research fields.

Formula: C₁₂H₁₂ClF₃O₃

InChI: InChI=1S/C12H12ClF3O3/c1-2-18-11(17)5-6-19-10-4-3-8(7-9(10)13)12(14,15)16/h3-4,7H,2,5-6H2,1H3

InChI key: InChIKey=OEGVPGPCKZEQCE-UHFFFAOYSA-N

SMILES: C(F)(F)(F)C1=CC(Cl)=C(OCCC(OCC)=O)C=C1

Synonyms:

• Propanoic acid, 3-[2-chloro-4-(trifluoromethyl)phenoxy]-, ethyl ester
• Ethyl 3-[2-chloro-4-(trifluoromethyl)phenoxy]propanoate