CAS 1443348-43-3

3-(Butylthio)benzenemethanol

Description:

3-(Butylthio)benzenemethanol, identified by its CAS number 1443348-43-3, is an organic compound characterized by the presence of a butylthio group attached to a benzene ring, which is further connected to a hydroxymethyl group. This compound typically exhibits properties associated with both aromatic and aliphatic structures, including potential hydrophobic characteristics due to the butyl group. The presence of the hydroxymethyl group suggests that it may engage in hydrogen bonding, influencing its solubility and reactivity. In terms of applications, compounds with similar structures are often explored in fields such as pharmaceuticals, agrochemicals, and materials science due to their potential biological activity and utility as intermediates in organic synthesis. The specific reactivity and stability of 3-(Butylthio)benzenemethanol would depend on its molecular interactions and the functional groups present, making it a subject of interest for further research in chemical and biological contexts.

Formula: C₁₁H₁₆OS

InChI: InChI=1S/C11H16OS/c1-2-3-7-13-11-6-4-5-10(8-11)9-12/h4-6,8,12H,2-3,7,9H2,1H3

InChI key: InChIKey=GGDWECRJJYKYPS-UHFFFAOYSA-N

SMILES: S(CCCC)C1=CC(CO)=CC=C1

Synonyms:

• 3-(Butylthio)benzenemethanol
• Benzenemethanol, 3-(butylthio)-

3-n-Butylthiobenzyl alcohol

CAS: 1443348-43-3

Formula: C₁₁H₁₆OS

Purity: 97.0%

Molecular weight: 196.31

Ref: 10-F398439

[3-(Butylsulfanyl)phenyl]methanol

CAS: 1443348-43-3

Versatile small molecule scaffold

Formula: C₁₁H₁₆OS

Purity: Min. 95%

Molecular weight: 196.31 g/mol

Ref: 3D-THC34843