CymitQuimica logo

CAS 1443349-00-5

:

2,4-Dimethoxy-α-methyl-α-propylbenzenemethanol

Description:
2,4-Dimethoxy-α-methyl-α-propylbenzenemethanol, identified by its CAS number 1443349-00-5, is an organic compound characterized by its complex structure, which includes a benzene ring substituted with two methoxy groups and a propyl side chain. This compound is likely to exhibit properties typical of aromatic alcohols, such as moderate solubility in organic solvents and potential reactivity due to the presence of hydroxyl (-OH) and methoxy (-OCH3) functional groups. The methoxy groups can influence the compound's electronic properties, potentially affecting its reactivity and interactions with other molecules. Additionally, the presence of the bulky propyl group may impart steric hindrance, which can affect the compound's overall stability and reactivity. While specific physical properties such as boiling point, melting point, and density are not provided, compounds of this nature often have moderate to high boiling points due to their molecular weight and the presence of polar functional groups. Overall, 2,4-Dimethoxy-α-methyl-α-propylbenzenemethanol is a compound of interest in organic chemistry, potentially relevant in various applications, including pharmaceuticals and materials science.
Formula:C13H20O3
InChI:InChI=1S/C13H20O3/c1-5-8-13(2,14)11-7-6-10(15-3)9-12(11)16-4/h6-7,9,14H,5,8H2,1-4H3
InChI key:InChIKey=ZEBDLIPVROCQKD-UHFFFAOYSA-N
SMILES:C(CCC)(C)(O)C1=C(OC)C=C(OC)C=C1
Synonyms:
  • 2,4-Dimethoxy-α-methyl-α-propylbenzenemethanol
  • Benzenemethanol, 2,4-dimethoxy-α-methyl-α-propyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.