CAS 1443349-51-6
:2-[2-(4-Bromo-3-methylphenoxy)ethyl]-1,3-dioxolane
Description:
2-[2-(4-Bromo-3-methylphenoxy)ethyl]-1,3-dioxolane is an organic compound characterized by its unique structure, which includes a dioxolane ring and a phenoxy group substituted with a bromine atom and a methyl group. The presence of the dioxolane moiety suggests that this compound may exhibit properties typical of cyclic ethers, such as moderate polarity and potential reactivity in nucleophilic substitution reactions. The bromine substituent on the aromatic ring can enhance the compound's reactivity, making it a potential candidate for further chemical transformations. Additionally, the methyl group may influence the compound's steric and electronic properties, affecting its solubility and interaction with biological systems. This compound may find applications in medicinal chemistry or as an intermediate in organic synthesis, although specific biological activity or applications would require further investigation. Overall, its structural features suggest a versatile compound with potential utility in various chemical contexts.
Formula:C12H15BrO3
InChI:InChI=1S/C12H15BrO3/c1-9-8-10(2-3-11(9)13)14-5-4-12-15-6-7-16-12/h2-3,8,12H,4-7H2,1H3
InChI key:InChIKey=KPUNCBOCAWYYDQ-UHFFFAOYSA-N
SMILES:O(CCC1OCCO1)C2=CC(C)=C(Br)C=C2
Synonyms:- 2-[2-(4-Bromo-3-methylphenoxy)ethyl]-1,3-dioxolane
- 1,3-Dioxolane, 2-[2-(4-bromo-3-methylphenoxy)ethyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.