CymitQuimica logo

CAS 1443349-96-9

:

2-[2-(5-Bromo-2-fluorophenoxy)ethyl]-1,3-dioxolane

Description:
2-[2-(5-Bromo-2-fluorophenoxy)ethyl]-1,3-dioxolane is a chemical compound characterized by its unique structure, which includes a dioxolane ring and a phenoxy group substituted with bromine and fluorine atoms. This compound typically exhibits properties such as moderate polarity due to the presence of the dioxolane moiety, which can influence its solubility in various solvents. The bromine and fluorine substituents on the phenyl ring can enhance the compound's reactivity and may impart specific biological activities, making it of interest in medicinal chemistry. Additionally, the presence of the ether linkage contributes to its stability and potential applications in organic synthesis. The compound's molecular structure suggests it may participate in various chemical reactions, including nucleophilic substitutions and electrophilic aromatic substitutions. Overall, 2-[2-(5-Bromo-2-fluorophenoxy)ethyl]-1,3-dioxolane is a versatile compound with potential applications in pharmaceuticals and agrochemicals, although specific properties such as melting point, boiling point, and reactivity would require empirical data for precise characterization.
Formula:C11H12BrFO3
InChI:InChI=1S/C11H12BrFO3/c12-8-1-2-9(13)10(7-8)14-4-3-11-15-5-6-16-11/h1-2,7,11H,3-6H2
InChI key:InChIKey=HFSFUZQQVIJOTI-UHFFFAOYSA-N
SMILES:O(CCC1OCCO1)C2=C(F)C=CC(Br)=C2
Synonyms:
  • 1,3-Dioxolane, 2-[2-(5-bromo-2-fluorophenoxy)ethyl]-
  • 2-[2-(5-Bromo-2-fluorophenoxy)ethyl]-1,3-dioxolane
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.