CymitQuimica logo

CAS 1443350-29-5

:

5-Methyl-α-[2-(methylthio)phenyl]-2-furanmethanol

Description:
5-Methyl-α-[2-(methylthio)phenyl]-2-furanmethanol is an organic compound characterized by its complex structure, which includes a furan ring, a methylthio group, and a phenyl moiety. This compound features a furan methanol functional group, indicating the presence of both a furan ring and a hydroxymethyl group. The methylthio group contributes to its unique chemical properties, potentially influencing its reactivity and solubility. The presence of the methyl group on the furan ring suggests that it may exhibit specific steric and electronic effects, which can affect its interactions in chemical reactions. Additionally, the compound may possess interesting biological activities, making it a subject of interest in medicinal chemistry. Its molecular structure allows for various potential applications, including in pharmaceuticals or as a precursor in organic synthesis. However, detailed studies on its physical properties, such as melting point, boiling point, and solubility, would be necessary to fully understand its characteristics and potential uses.
Formula:C13H14O2S
InChI:InChI=1S/C13H14O2S/c1-9-7-8-11(15-9)13(14)10-5-3-4-6-12(10)16-2/h3-8,13-14H,1-2H3
InChI key:InChIKey=CKLXPAZZWDFWCE-UHFFFAOYSA-N
SMILES:C(O)(C1=C(SC)C=CC=C1)C2=CC=C(C)O2
Synonyms:
  • 5-Methyl-α-[2-(methylthio)phenyl]-2-furanmethanol
  • 2-Furanmethanol, 5-methyl-α-[2-(methylthio)phenyl]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.