CymitQuimica logo

CAS 1443353-90-9

:

Methyl 1-[(4-chloro-2-fluorophenyl)methyl]-4-piperidinecarboxylate

Description:
Methyl 1-[(4-chloro-2-fluorophenyl)methyl]-4-piperidinecarboxylate is a chemical compound characterized by its piperidine core, which is a six-membered ring containing one nitrogen atom. This compound features a methyl ester functional group, contributing to its solubility and reactivity. The presence of a 4-chloro-2-fluorophenyl group indicates that it has halogen substituents, which can influence its biological activity and chemical properties. The chlorine and fluorine atoms can enhance lipophilicity and potentially affect the compound's interaction with biological targets. This substance may exhibit pharmacological properties, making it of interest in medicinal chemistry, particularly in the development of therapeutic agents. Its molecular structure suggests potential applications in various fields, including drug development and chemical synthesis. As with many organic compounds, safety and handling precautions are essential, given the presence of halogens, which can pose health risks. Overall, this compound represents a complex structure with potential utility in various chemical and pharmaceutical applications.
Formula:C14H17ClFNO2
InChI:InChI=1S/C14H17ClFNO2/c1-19-14(18)10-4-6-17(7-5-10)9-11-2-3-12(15)8-13(11)16/h2-3,8,10H,4-7,9H2,1H3
InChI key:InChIKey=XGQOUBQTFXRINM-UHFFFAOYSA-N
SMILES:C(C1=C(F)C=C(Cl)C=C1)N2CCC(C(OC)=O)CC2
Synonyms:
  • 4-Piperidinecarboxylic acid, 1-[(4-chloro-2-fluorophenyl)methyl]-, methyl ester
  • Methyl 1-[(4-chloro-2-fluorophenyl)methyl]-4-piperidinecarboxylate
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.