CAS 1443355-26-7: 4-[[(Tetrahydro-2-furanyl)methoxy]methyl]benzenethiol

Description:4-[[(Tetrahydro-2-furanyl)methoxy]methyl]benzenethiol, identified by its CAS number 1443355-26-7, is an organic compound characterized by its unique molecular structure that includes a thiol group (-SH) attached to a benzene ring. The presence of the tetrahydro-2-furanyl group suggests that the compound has a cyclic ether component, which can influence its reactivity and solubility. This compound may exhibit properties typical of thiols, such as a strong odor and the ability to form disulfide bonds under oxidative conditions. Additionally, the methoxy and methyl substituents can enhance its lipophilicity, potentially affecting its biological activity and interaction with other molecules. The compound's specific characteristics, such as melting point, boiling point, and solubility, would depend on its molecular interactions and the presence of functional groups. Overall, this compound may have applications in organic synthesis, medicinal chemistry, or as a building block in the development of more complex molecules.

Formula:C₁₂H₁₆O₂S

InChI:InChI=1S/C12H16O2S/c15-12-5-3-10(4-6-12)8-13-9-11-2-1-7-14-11/h3-6,11,15H,1-2,7-9H2

InChI key:InChIKey=ZTMAHJKEJBGFJR-UHFFFAOYSA-N

SMILES:SC1=CC=C(C=C1)COCC2OCCC2