CAS 1443378-60-6

7-Bromo-4-chloro-6-fluoroquinoline

Description:

7-Bromo-4-chloro-6-fluoroquinoline is a synthetic organic compound belonging to the quinoline family, characterized by its heterocyclic structure that includes a fused benzene and pyridine ring. This compound features three halogen substituents: bromine, chlorine, and fluorine, which significantly influence its chemical reactivity and biological activity. The presence of these halogens can enhance the compound's lipophilicity and may affect its interaction with biological targets, making it of interest in medicinal chemistry, particularly in the development of pharmaceuticals. The compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. Its molecular structure suggests potential applications in areas such as antimicrobial or anticancer research, as many quinoline derivatives have demonstrated significant biological activities. Safety and handling precautions should be observed due to the presence of halogens, which can pose health risks. As with any chemical substance, thorough characterization through techniques such as NMR, IR spectroscopy, and mass spectrometry is essential for confirming its identity and purity.

Formula: C₉H₄BrClFN

InChI: InChI=1S/C9H4BrClFN/c10-6-4-9-5(3-8(6)12)7(11)1-2-13-9/h1-4H

InChI key: InChIKey=DLAIAXCCQGNMEN-UHFFFAOYSA-N

SMILES: ClC=1C2=C(C=C(Br)C(F)=C2)N=CC1

Synonyms:

• 7-Bromo-4-chloro-6-fluoroquinoline
• Quinoline, 7-bromo-4-chloro-6-fluoro-